![]() |
Name |
Copaene
|
Molecular Formula | C15H24 | |
IUPAC Name* |
1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene
|
|
SMILES |
CC1=CCC2C3C1C2(CCC3C(C)C)C
|
|
InChI |
InChI=1S/C15H24/c1-9(2)11-7-8-15(4)12-6-5-10(3)14(15)13(11)12/h5,9,11-14H,6-8H2,1-4H3
|
|
InChIKey |
VLXDPFLIRFYIME-UHFFFAOYSA-N
|
|
Synonyms |
Copaene; ALPHA-COPAENE; 3856-25-5; .alpha.-Copaene; (-)-alpha-Copaene; ylangene (alpha-); DTXSID70863280; FT-0694804; 1,3-Dimethyl-8-(propan-2-yl)tricyclo[4.4.0.0~2,7~]dec-3-ene
|
|
CAS | 138874-68-7 | |
PubChem CID | 19725 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 204.35 | ALogp: | 4.5 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 15 | QED Weighted: | 0.537 |
Caco-2 Permeability: | -4.357 | MDCK Permeability: | 0.00001410 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.027 |
30% Bioavailability (F30%): | 0.578 |
Blood-Brain-Barrier Penetration (BBB): | 0.664 | Plasma Protein Binding (PPB): | 97.26% |
Volume Distribution (VD): | 3.393 | Fu: | 2.58% |
CYP1A2-inhibitor: | 0.323 | CYP1A2-substrate: | 0.593 |
CYP2C19-inhibitor: | 0.225 | CYP2C19-substrate: | 0.933 |
CYP2C9-inhibitor: | 0.332 | CYP2C9-substrate: | 0.351 |
CYP2D6-inhibitor: | 0.018 | CYP2D6-substrate: | 0.479 |
CYP3A4-inhibitor: | 0.157 | CYP3A4-substrate: | 0.42 |
Clearance (CL): | 19.832 | Half-life (T1/2): | 0.059 |
hERG Blockers: | 0.027 | Human Hepatotoxicity (H-HT): | 0.25 |
Drug-inuced Liver Injury (DILI): | 0.073 | AMES Toxicity: | 0.015 |
Rat Oral Acute Toxicity: | 0.451 | Maximum Recommended Daily Dose: | 0.572 |
Skin Sensitization: | 0.046 | Carcinogencity: | 0.061 |
Eye Corrosion: | 0.011 | Eye Irritation: | 0.029 |
Respiratory Toxicity: | 0.545 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003142 | ![]() |
0.615 | D04CSZ | ![]() |
0.296 | ||
ENC002553 | ![]() |
0.577 | D0A2AJ | ![]() |
0.264 | ||
ENC005929 | ![]() |
0.458 | D0Y7LD | ![]() |
0.253 | ||
ENC005930 | ![]() |
0.458 | D0B4RU | ![]() |
0.250 | ||
ENC001140 | ![]() |
0.439 | D07BSQ | ![]() |
0.221 | ||
ENC002017 | ![]() |
0.424 | D0F1UL | ![]() |
0.221 | ||
ENC001293 | ![]() |
0.417 | D0K0EK | ![]() |
0.220 | ||
ENC002224 | ![]() |
0.414 | D06XMU | ![]() |
0.220 | ||
ENC002223 | ![]() |
0.414 | D04SFH | ![]() |
0.211 | ||
ENC000831 | ![]() |
0.414 | D08IWD | ![]() |
0.211 |