![]() |
Name |
L-Proline, N-valeryl-, tetradecyl ester
|
Molecular Formula | C24H45NO3 | |
IUPAC Name* |
tetradecyl 1-pentanoylpyrrolidine-2-carboxylate
|
|
SMILES |
CCCCCCCCCCCCCCOC(=O)C1CCCN1C(=O)CCCC
|
|
InChI |
InChI=1S/C24H45NO3/c1-3-5-7-8-9-10-11-12-13-14-15-16-21-28-24(27)22-18-17-20-25(22)23(26)19-6-4-2/h22H,3-21H2,1-2H3
|
|
InChIKey |
DEZQILJMZVXCJQ-UHFFFAOYSA-N
|
|
Synonyms |
L-Proline, N-valeryl-, tetradecyl ester
|
|
CAS | NA | |
PubChem CID | 91695471 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 395.6 | ALogp: | 8.2 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 18 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 46.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 28 | QED Weighted: | 0.212 |
Caco-2 Permeability: | -4.884 | MDCK Permeability: | 0.00001770 |
Pgp-inhibitor: | 0.017 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.999 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.133 | Plasma Protein Binding (PPB): | 97.14% |
Volume Distribution (VD): | 0.815 | Fu: | 1.89% |
CYP1A2-inhibitor: | 0.153 | CYP1A2-substrate: | 0.191 |
CYP2C19-inhibitor: | 0.41 | CYP2C19-substrate: | 0.075 |
CYP2C9-inhibitor: | 0.268 | CYP2C9-substrate: | 0.915 |
CYP2D6-inhibitor: | 0.126 | CYP2D6-substrate: | 0.063 |
CYP3A4-inhibitor: | 0.703 | CYP3A4-substrate: | 0.068 |
Clearance (CL): | 5.31 | Half-life (T1/2): | 0.074 |
hERG Blockers: | 0.558 | Human Hepatotoxicity (H-HT): | 0.481 |
Drug-inuced Liver Injury (DILI): | 0.237 | AMES Toxicity: | 0.002 |
Rat Oral Acute Toxicity: | 0.013 | Maximum Recommended Daily Dose: | 0.043 |
Skin Sensitization: | 0.955 | Carcinogencity: | 0.038 |
Eye Corrosion: | 0.016 | Eye Irritation: | 0.083 |
Respiratory Toxicity: | 0.11 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003069 | ![]() |
0.888 | D07ILQ | ![]() |
0.489 | ||
ENC001803 | ![]() |
0.707 | D0Z5SM | ![]() |
0.473 | ||
ENC001234 | ![]() |
0.667 | D00FGR | ![]() |
0.435 | ||
ENC001218 | ![]() |
0.604 | D05ATI | ![]() |
0.411 | ||
ENC000424 | ![]() |
0.575 | D00AOJ | ![]() |
0.400 | ||
ENC000419 | ![]() |
0.557 | D0O1PH | ![]() |
0.390 | ||
ENC000575 | ![]() |
0.556 | D00MLW | ![]() |
0.390 | ||
ENC000601 | ![]() |
0.556 | D0T9TJ | ![]() |
0.380 | ||
ENC000765 | ![]() |
0.550 | D00STJ | ![]() |
0.338 | ||
ENC003077 | ![]() |
0.547 | D03ZJE | ![]() |
0.337 |