![]() |
Name |
l-Proline, N-allyloxycarbonyl-, heptadecyl ester
|
Molecular Formula | C26H47NO4 | |
IUPAC Name* |
2-O-heptadecyl 1-O-prop-2-enyl pyrrolidine-1,2-dicarboxylate
|
|
SMILES |
CCCCCCCCCCCCCCCCCOC(=O)C1CCCN1C(=O)OCC=C
|
|
InChI |
InChI=1S/C26H47NO4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-30-25(28)24-20-19-21-27(24)26(29)31-22-4-2/h4,24H,2-3,5-23H2,1H3
|
|
InChIKey |
UDEKIWFRXKOMMF-UHFFFAOYSA-N
|
|
Synonyms |
l-Proline, N-allyloxycarbonyl-, heptadecyl ester
|
|
CAS | NA | |
PubChem CID | 6424275 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 437.7 | ALogp: | 9.5 |
HBD: | 0 | HBA: | 4 |
Rotatable Bonds: | 21 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 55.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 31 | QED Weighted: | 0.122 |
Caco-2 Permeability: | -4.917 | MDCK Permeability: | 0.00002090 |
Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.001 | 20% Bioavailability (F20%): | 0.868 |
30% Bioavailability (F30%): | 0.995 |
Blood-Brain-Barrier Penetration (BBB): | 0.101 | Plasma Protein Binding (PPB): | 98.54% |
Volume Distribution (VD): | 1.13 | Fu: | 1.63% |
CYP1A2-inhibitor: | 0.115 | CYP1A2-substrate: | 0.164 |
CYP2C19-inhibitor: | 0.371 | CYP2C19-substrate: | 0.066 |
CYP2C9-inhibitor: | 0.161 | CYP2C9-substrate: | 0.901 |
CYP2D6-inhibitor: | 0.495 | CYP2D6-substrate: | 0.12 |
CYP3A4-inhibitor: | 0.76 | CYP3A4-substrate: | 0.108 |
Clearance (CL): | 3.33 | Half-life (T1/2): | 0.049 |
hERG Blockers: | 0.43 | Human Hepatotoxicity (H-HT): | 0.216 |
Drug-inuced Liver Injury (DILI): | 0.346 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.046 | Maximum Recommended Daily Dose: | 0.042 |
Skin Sensitization: | 0.961 | Carcinogencity: | 0.166 |
Eye Corrosion: | 0.014 | Eye Irritation: | 0.064 |
Respiratory Toxicity: | 0.643 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003070 | ![]() |
0.707 | D00FGR | ![]() |
0.451 | ||
ENC003069 | ![]() |
0.616 | D07ILQ | ![]() |
0.447 | ||
ENC001243 | ![]() |
0.566 | D00AOJ | ![]() |
0.444 | ||
ENC000424 | ![]() |
0.553 | D0Z5SM | ![]() |
0.430 | ||
ENC000589 | ![]() |
0.548 | D05ATI | ![]() |
0.374 | ||
ENC001163 | ![]() |
0.544 | D00STJ | ![]() |
0.362 | ||
ENC000258 | ![]() |
0.535 | D0O1PH | ![]() |
0.360 | ||
ENC001218 | ![]() |
0.535 | D00MLW | ![]() |
0.341 | ||
ENC003077 | ![]() |
0.531 | D0T9TJ | ![]() |
0.336 | ||
ENC002300 | ![]() |
0.528 | D03ZJE | ![]() |
0.298 |