![]() |
Name |
Epicocconigrone A
|
Molecular Formula | C18H14O9 | |
IUPAC Name* |
(1S,9R)-5,6,12,13,14-pentahydroxy-4,11-dimethyl-16-oxo-8,17-dioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10,12,14-hexaene-3-carbaldehyde
|
|
SMILES |
CC1=C(C2=C(C(=C1O)O)O[C@@H]3C4=C(C(=C(C(=C4C(=O)[C@H]2O3)O)O)O)C)C=O
|
|
InChI |
InChI=1S/C18H14O9/c1-4-6(3-19)8-16-13(23)9-7(5(2)11(21)14(24)12(9)22)18(26-16)27-17(8)15(25)10(4)20/h3,16,18,20-22,24-25H,1-2H3/t16-,18+/m0/s1
|
|
InChIKey |
AHNFXMBOWJVAPB-FUHWJXTLSA-N
|
|
Synonyms |
CHEMBL3104851; Epicocconigrone A; BDBM50445473
|
|
CAS | NA | |
PubChem CID | 73891099 | |
ChEMBL ID | CHEMBL3104851 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 374.3 | ALogp: | 1.7 |
HBD: | 5 | HBA: | 9 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 154.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 27 | QED Weighted: | 0.374 |
Caco-2 Permeability: | -5.783 | MDCK Permeability: | 0.00000378 |
Pgp-inhibitor: | 0.016 | Pgp-substrate: | 0.012 |
Human Intestinal Absorption (HIA): | 0.046 | 20% Bioavailability (F20%): | 0.068 |
30% Bioavailability (F30%): | 0.84 |
Blood-Brain-Barrier Penetration (BBB): | 0.005 | Plasma Protein Binding (PPB): | 98.91% |
Volume Distribution (VD): | 0.405 | Fu: | 4.75% |
CYP1A2-inhibitor: | 0.059 | CYP1A2-substrate: | 0.102 |
CYP2C19-inhibitor: | 0.022 | CYP2C19-substrate: | 0.071 |
CYP2C9-inhibitor: | 0.24 | CYP2C9-substrate: | 0.378 |
CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.143 |
CYP3A4-inhibitor: | 0.085 | CYP3A4-substrate: | 0.105 |
Clearance (CL): | 1.161 | Half-life (T1/2): | 0.505 |
hERG Blockers: | 0.002 | Human Hepatotoxicity (H-HT): | 0.279 |
Drug-inuced Liver Injury (DILI): | 0.96 | AMES Toxicity: | 0.758 |
Rat Oral Acute Toxicity: | 0.205 | Maximum Recommended Daily Dose: | 0.601 |
Skin Sensitization: | 0.94 | Carcinogencity: | 0.75 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.917 |
Respiratory Toxicity: | 0.145 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002948 | ![]() |
0.895 | D0K8KX | ![]() |
0.222 | ||
ENC002123 | ![]() |
0.500 | D0WY9N | ![]() |
0.221 | ||
ENC003996 | ![]() |
0.447 | D0R9WP | ![]() |
0.219 | ||
ENC003995 | ![]() |
0.447 | D07JHH | ![]() |
0.215 | ||
ENC003994 | ![]() |
0.447 | D0FX2Q | ![]() |
0.213 | ||
ENC002859 | ![]() |
0.440 | D0C9XJ | ![]() |
0.211 | ||
ENC004924 | ![]() |
0.388 | D07VLY | ![]() |
0.211 | ||
ENC004923 | ![]() |
0.362 | D0G3DL | ![]() |
0.209 | ||
ENC001496 | ![]() |
0.350 | D0H1AR | ![]() |
0.209 | ||
ENC004202 | ![]() |
0.344 | D01XWG | ![]() |
0.207 |