![]() |
Name |
4-benzyl-9-[3-[(5-benzyl-3,6-dioxopiperazin-2-yl)methyl]-1H-indol-7-yl]-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione
|
Molecular Formula | C40H36N6O4 | |
IUPAC Name* |
4-benzyl-9-[3-[(5-benzyl-3,6-dioxopiperazin-2-yl)methyl]-1H-indol-7-yl]-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione
|
|
SMILES |
C1C2C(=O)NC(C(=O)N2C3C1(C4=CC=CC=C4N3)C5=CC=CC6=C5NC=C6CC7C(=O)NC(C(=O)N7)CC8=CC=CC=C8)CC9=CC=CC=C9
|
|
InChI |
InChI=1S/C40H36N6O4/c47-35-30(18-23-10-3-1-4-11-23)42-36(48)31(43-35)20-25-22-41-34-26(25)14-9-16-28(34)40-21-33-37(49)44-32(19-24-12-5-2-6-13-24)38(50)46(33)39(40)45-29-17-8-7-15-27(29)40/h1-17,22,30-33,39,41,45H,18-21H2,(H,42,48)(H,43,47)(H,44,49)
|
|
InChIKey |
AWMBNXCUMNOLQI-UHFFFAOYSA-N
|
|
Synonyms |
Asperazine; MLS005941360; SMR004614074
|
|
CAS | NA | |
PubChem CID | 72795133 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 664.7 | ALogp: | 5.2 |
HBD: | 5 | HBA: | 5 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 135.0 | Aromatic Rings: | 9 |
Heavy Atoms: | 50 | QED Weighted: | 0.179 |
Caco-2 Permeability: | -5.494 | MDCK Permeability: | 0.00008880 |
Pgp-inhibitor: | 0.99 | Pgp-substrate: | 0.083 |
Human Intestinal Absorption (HIA): | 0.986 | 20% Bioavailability (F20%): | 0.973 |
30% Bioavailability (F30%): | 0.955 |
Blood-Brain-Barrier Penetration (BBB): | 0.021 | Plasma Protein Binding (PPB): | 98.14% |
Volume Distribution (VD): | 0.764 | Fu: | 1.89% |
CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.076 |
CYP2C19-inhibitor: | 0.901 | CYP2C19-substrate: | 0.064 |
CYP2C9-inhibitor: | 0.971 | CYP2C9-substrate: | 0.796 |
CYP2D6-inhibitor: | 0.647 | CYP2D6-substrate: | 0.185 |
CYP3A4-inhibitor: | 0.988 | CYP3A4-substrate: | 0.895 |
Clearance (CL): | 2.339 | Half-life (T1/2): | 0.165 |
hERG Blockers: | 0.164 | Human Hepatotoxicity (H-HT): | 0.735 |
Drug-inuced Liver Injury (DILI): | 0.853 | AMES Toxicity: | 0.228 |
Rat Oral Acute Toxicity: | 0.993 | Maximum Recommended Daily Dose: | 0.844 |
Skin Sensitization: | 0.123 | Carcinogencity: | 0.128 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
Respiratory Toxicity: | 0.045 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004971 | ![]() |
0.466 | D02XIY | ![]() |
0.432 | ||
ENC001912 | ![]() |
0.450 | D0TV0C | ![]() |
0.411 | ||
ENC004531 | ![]() |
0.450 | D07DSQ | ![]() |
0.404 | ||
ENC004934 | ![]() |
0.450 | D0M2YE | ![]() |
0.367 | ||
ENC004891 | ![]() |
0.446 | D0X9PF | ![]() |
0.351 | ||
ENC001911 | ![]() |
0.390 | D0J7CP | ![]() |
0.333 | ||
ENC002149 | ![]() |
0.377 | D06TFE | ![]() |
0.330 | ||
ENC001481 | ![]() |
0.376 | D0J7XL | ![]() |
0.329 | ||
ENC003591 | ![]() |
0.373 | D0H3MG | ![]() |
0.326 | ||
ENC003424 | ![]() |
0.361 | D03DEI | ![]() |
0.299 |