|
Name |
(3S,6R)-3-[(4-hydroxyphenyl)methyl]-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione
|
Molecular Formula | C20H19N3O3 | |
IUPAC Name* |
(3S,6R)-3-[(4-hydroxyphenyl)methyl]-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione
|
|
SMILES |
C1=CC=C2C(=C1)C(=CN2)C[C@@H]3C(=O)N[C@H](C(=O)N3)CC4=CC=C(C=C4)O
|
|
InChI |
InChI=1S/C20H19N3O3/c24-14-7-5-12(6-8-14)9-17-19(25)23-18(20(26)22-17)10-13-11-21-16-4-2-1-3-15(13)16/h1-8,11,17-18,21,24H,9-10H2,(H,22,26)(H,23,25)/t17-,18+/m0/s1
|
|
InChIKey |
ZJDMXAAEAVGGSK-ZWKOTPCHSA-N
|
|
Synonyms |
Cyclo(-D-Trp-Tyr); 852955-00-1; (3S,6R)-3-[(4-hydroxyphenyl)methyl]-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione; Cyclo(D-Trp-L-Tyr-); CHEMBL556683; ZINC4899656; MFCD00236943; Trans-cyclo-(D-tryptophanyl-L-tyrosyl)
|
|
CAS | NA | |
PubChem CID | 7408398 | |
ChEMBL ID | CHEMBL556683 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 349.4 | ALogp: | 2.4 |
HBD: | 4 | HBA: | 3 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 94.2 | Aromatic Rings: | 4 |
Heavy Atoms: | 26 | QED Weighted: | 0.582 |
Caco-2 Permeability: | -4.897 | MDCK Permeability: | 0.00000543 |
Pgp-inhibitor: | 0.012 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.883 | 20% Bioavailability (F20%): | 0.981 |
30% Bioavailability (F30%): | 0.996 |
Blood-Brain-Barrier Penetration (BBB): | 0.068 | Plasma Protein Binding (PPB): | 91.47% |
Volume Distribution (VD): | 0.512 | Fu: | 13.35% |
CYP1A2-inhibitor: | 0.162 | CYP1A2-substrate: | 0.106 |
CYP2C19-inhibitor: | 0.769 | CYP2C19-substrate: | 0.058 |
CYP2C9-inhibitor: | 0.666 | CYP2C9-substrate: | 0.928 |
CYP2D6-inhibitor: | 0.463 | CYP2D6-substrate: | 0.868 |
CYP3A4-inhibitor: | 0.886 | CYP3A4-substrate: | 0.141 |
Clearance (CL): | 6.712 | Half-life (T1/2): | 0.818 |
hERG Blockers: | 0.293 | Human Hepatotoxicity (H-HT): | 0.341 |
Drug-inuced Liver Injury (DILI): | 0.177 | AMES Toxicity: | 0.606 |
Rat Oral Acute Toxicity: | 0.712 | Maximum Recommended Daily Dose: | 0.813 |
Skin Sensitization: | 0.288 | Carcinogencity: | 0.174 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.056 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001912 | 0.762 | D0S2BV | 0.360 | ||||
ENC004531 | 0.762 | D02DMQ | 0.354 | ||||
ENC004934 | 0.762 | D06ZPS | 0.349 | ||||
ENC002149 | 0.720 | D0M2YE | 0.349 | ||||
ENC004971 | 0.600 | D0H6TP | 0.337 | ||||
ENC004711 | 0.558 | D07DSQ | 0.332 | ||||
ENC003593 | 0.538 | D02XIY | 0.330 | ||||
ENC001905 | 0.512 | D05EJG | 0.330 | ||||
ENC004931 | 0.490 | D0E3SH | 0.316 | ||||
ENC002604 | 0.477 | D0X9PF | 0.304 |