![]() |
Name |
Cytoglobosin G
|
Molecular Formula | C32H40N2O5 | |
IUPAC Name* |
(1R,5S,6R,7E,9S,11E,13R,14S,16S,17R,18S)-5,6,14-trihydroxy-18-(1H-indol-3-ylmethyl)-7,9,16-trimethyl-15-methylidene-19-azatricyclo[11.7.0.01,17]icosa-7,11-diene-2,20-dione
|
|
SMILES |
C[C@H]\1C/C=C/[C@H]2[C@@H](C(=C)[C@H]([C@@H]3[C@@]2(C(=O)CC[C@@H]([C@@H](/C(=C1)/C)O)O)C(=O)N[C@H]3CC4=CNC5=CC=CC=C54)C)O
|
|
InChI |
InChI=1S/C32H40N2O5/c1-17-8-7-10-23-30(38)20(4)19(3)28-25(15-21-16-33-24-11-6-5-9-22(21)24)34-31(39)32(23,28)27(36)13-12-26(35)29(37)18(2)14-17/h5-7,9-11,14,16-17,19,23,25-26,28-30,33,35,37-38H,4,8,12-13,15H2,1-3H3,(H,34,39)/b10-7+,18-14+/t17-,19+,23-,25-,26-,28-,29+,30+,32+/m0/s1
|
|
InChIKey |
XVRIIIGIWIPYAY-JFRRKLIBSA-N
|
|
Synonyms |
Cytoglobosin G; CHEBI:68765; Q27137168; (3S,3aR,4S,6S,6aR,7E,10S,11E,13R,14S,17aR)-6,13,14-trihydroxy-3-(1H-indol-3-ylmethyl)-4,10,12-trimethyl-5-methylene-3,3a,4,5,6,6a,9,10,13,14,15,16-dodecahydro-1H-cyclotrideca[d]isoindole-1,17(2H)-dione
|
|
CAS | NA | |
PubChem CID | 46209922 | |
ChEMBL ID | CHEMBL1098276 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 532.7 | ALogp: | 2.6 |
HBD: | 5 | HBA: | 5 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 123.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 39 | QED Weighted: | 0.291 |
Caco-2 Permeability: | -5.354 | MDCK Permeability: | 0.00000488 |
Pgp-inhibitor: | 0.012 | Pgp-substrate: | 0.998 |
Human Intestinal Absorption (HIA): | 0.519 | 20% Bioavailability (F20%): | 0.386 |
30% Bioavailability (F30%): | 0.03 |
Blood-Brain-Barrier Penetration (BBB): | 0.334 | Plasma Protein Binding (PPB): | 87.46% |
Volume Distribution (VD): | 0.833 | Fu: | 5.37% |
CYP1A2-inhibitor: | 0.043 | CYP1A2-substrate: | 0.123 |
CYP2C19-inhibitor: | 0.169 | CYP2C19-substrate: | 0.619 |
CYP2C9-inhibitor: | 0.127 | CYP2C9-substrate: | 0.804 |
CYP2D6-inhibitor: | 0.025 | CYP2D6-substrate: | 0.272 |
CYP3A4-inhibitor: | 0.865 | CYP3A4-substrate: | 0.204 |
Clearance (CL): | 6.847 | Half-life (T1/2): | 0.263 |
hERG Blockers: | 0.119 | Human Hepatotoxicity (H-HT): | 0.659 |
Drug-inuced Liver Injury (DILI): | 0.073 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.944 | Maximum Recommended Daily Dose: | 0.982 |
Skin Sensitization: | 0.213 | Carcinogencity: | 0.055 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.978 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002681 | ![]() |
0.815 | D02DMQ | ![]() |
0.265 | ||
ENC004447 | ![]() |
0.815 | D0SP3D | ![]() |
0.249 | ||
ENC002953 | ![]() |
0.800 | D09NNH | ![]() |
0.249 | ||
ENC005215 | ![]() |
0.783 | D0V3ZA | ![]() |
0.249 | ||
ENC002442 | ![]() |
0.742 | D01TSI | ![]() |
0.249 | ||
ENC002440 | ![]() |
0.728 | D0W7WC | ![]() |
0.240 | ||
ENC002678 | ![]() |
0.674 | D05EJG | ![]() |
0.240 | ||
ENC004470 | ![]() |
0.644 | D00YLW | ![]() |
0.236 | ||
ENC003586 | ![]() |
0.644 | D0K0KH | ![]() |
0.234 | ||
ENC002955 | ![]() |
0.636 | D09ZIO | ![]() |
0.230 |