![]() |
Name |
3'-Angeloyloxy-2',4'-dihydroxy-6'-methoxychalcone
|
Molecular Formula | C21H20O6 | |
IUPAC Name* |
[2,6-dihydroxy-4-methoxy-3-[(E)-3-phenylprop-2-enoyl]phenyl] (Z)-2-methylbut-2-enoate
|
|
SMILES |
C/C=C(/C)\C(=O)OC1=C(C(=C(C=C1O)OC)C(=O)/C=C/C2=CC=CC=C2)O
|
|
InChI |
InChI=1S/C21H20O6/c1-4-13(2)21(25)27-20-16(23)12-17(26-3)18(19(20)24)15(22)11-10-14-8-6-5-7-9-14/h4-12,23-24H,1-3H3/b11-10+,13-4-
|
|
InChIKey |
ZQUOUZKTJWTBQE-VVWRKKLTSA-N
|
|
Synonyms |
3'-Angeloyloxy-2',4'-dihydroxy-6'-methoxychalcone; LMPK12120332
|
|
CAS | NA | |
PubChem CID | 42607628 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 368.4 | ALogp: | 4.5 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 93.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 27 | QED Weighted: | 0.337 |
Caco-2 Permeability: | -4.825 | MDCK Permeability: | 0.00001410 |
Pgp-inhibitor: | 0.912 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.178 | Plasma Protein Binding (PPB): | 99.62% |
Volume Distribution (VD): | 0.317 | Fu: | 1.27% |
CYP1A2-inhibitor: | 0.969 | CYP1A2-substrate: | 0.622 |
CYP2C19-inhibitor: | 0.906 | CYP2C19-substrate: | 0.07 |
CYP2C9-inhibitor: | 0.921 | CYP2C9-substrate: | 0.931 |
CYP2D6-inhibitor: | 0.801 | CYP2D6-substrate: | 0.371 |
CYP3A4-inhibitor: | 0.748 | CYP3A4-substrate: | 0.227 |
Clearance (CL): | 5.744 | Half-life (T1/2): | 0.82 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.043 |
Drug-inuced Liver Injury (DILI): | 0.384 | AMES Toxicity: | 0.065 |
Rat Oral Acute Toxicity: | 0.73 | Maximum Recommended Daily Dose: | 0.415 |
Skin Sensitization: | 0.918 | Carcinogencity: | 0.525 |
Eye Corrosion: | 0.012 | Eye Irritation: | 0.952 |
Respiratory Toxicity: | 0.591 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002787 | ![]() |
0.396 | D0E6OC | ![]() |
0.382 | ||
ENC001848 | ![]() |
0.389 | D01ZJK | ![]() |
0.346 | ||
ENC001428 | ![]() |
0.382 | D0Y0JH | ![]() |
0.309 | ||
ENC001416 | ![]() |
0.369 | D0L1WV | ![]() |
0.309 | ||
ENC002396 | ![]() |
0.367 | D06BLQ | ![]() |
0.307 | ||
ENC002836 | ![]() |
0.363 | D03KOZ | ![]() |
0.294 | ||
ENC001443 | ![]() |
0.349 | D06GCK | ![]() |
0.288 | ||
ENC002453 | ![]() |
0.348 | D0L5PO | ![]() |
0.284 | ||
ENC001091 | ![]() |
0.346 | D0GY5Z | ![]() |
0.282 | ||
ENC001101 | ![]() |
0.333 | D0S5RZ | ![]() |
0.278 |