![]() |
Name |
(1S)-spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene]-1,8-diol
|
Molecular Formula | C20H16O4 | |
IUPAC Name* |
(1S)-spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene]-1,8-diol
|
|
SMILES |
C1CC2(C3=C([C@H]1O)C(=CC=C3)O)OC4=CC=CC5=C4C(=CC=C5)O2
|
|
InChI |
InChI=1S/C20H16O4/c21-14-7-3-6-13-19(14)15(22)10-11-20(13)23-16-8-1-4-12-5-2-9-17(24-20)18(12)16/h1-9,15,21-22H,10-11H2/t15-/m0/s1
|
|
InChIKey |
VPWWOWTXVIXWBW-HNNXBMFYSA-N
|
|
Synonyms |
CJ-12371; CHEMBL455963; CJ-12,371; (1S)-Spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene]-1,8-diol
|
|
CAS | NA | |
PubChem CID | 487653 | |
ChEMBL ID | CHEMBL455963 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 320.3 | ALogp: | 3.6 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 58.9 | Aromatic Rings: | 5 |
Heavy Atoms: | 24 | QED Weighted: | 0.634 |
Caco-2 Permeability: | -5.001 | MDCK Permeability: | 0.00001890 |
Pgp-inhibitor: | 0.024 | Pgp-substrate: | 0.257 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.065 |
30% Bioavailability (F30%): | 0.674 |
Blood-Brain-Barrier Penetration (BBB): | 0.506 | Plasma Protein Binding (PPB): | 97.54% |
Volume Distribution (VD): | 0.747 | Fu: | 1.99% |
CYP1A2-inhibitor: | 0.822 | CYP1A2-substrate: | 0.471 |
CYP2C19-inhibitor: | 0.9 | CYP2C19-substrate: | 0.363 |
CYP2C9-inhibitor: | 0.9 | CYP2C9-substrate: | 0.944 |
CYP2D6-inhibitor: | 0.717 | CYP2D6-substrate: | 0.329 |
CYP3A4-inhibitor: | 0.686 | CYP3A4-substrate: | 0.606 |
Clearance (CL): | 8.167 | Half-life (T1/2): | 0.731 |
hERG Blockers: | 0.043 | Human Hepatotoxicity (H-HT): | 0.296 |
Drug-inuced Liver Injury (DILI): | 0.284 | AMES Toxicity: | 0.946 |
Rat Oral Acute Toxicity: | 0.737 | Maximum Recommended Daily Dose: | 0.938 |
Skin Sensitization: | 0.772 | Carcinogencity: | 0.952 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.707 |
Respiratory Toxicity: | 0.931 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005582 | ![]() |
1.000 | D06TJJ | ![]() |
0.327 | ||
ENC005583 | ![]() |
0.810 | D0H8QL | ![]() |
0.267 | ||
ENC005524 | ![]() |
0.810 | D08CCE | ![]() |
0.262 | ||
ENC001956 | ![]() |
0.707 | D0H6QU | ![]() |
0.257 | ||
ENC003746 | ![]() |
0.644 | D03KQF | ![]() |
0.257 | ||
ENC002531 | ![]() |
0.596 | D0O6IZ | ![]() |
0.255 | ||
ENC002530 | ![]() |
0.578 | D02NTO | ![]() |
0.255 | ||
ENC000996 | ![]() |
0.573 | D0H6TP | ![]() |
0.253 | ||
ENC005548 | ![]() |
0.562 | D0I0DL | ![]() |
0.252 | ||
ENC003199 | ![]() |
0.560 | D06ZEE | ![]() |
0.252 |