![]() |
Name |
trichodermamide C
|
Molecular Formula | C21H22N2O9 | |
IUPAC Name* |
(4aS,5R,8R,8aS)-N-(7,8-dimethoxy-2-oxochromen-3-yl)-4a,5,8-trihydroxy-N-methyl-4,5,8,8a-tetrahydro-1,2-benzoxazine-3-carboxamide
|
|
SMILES |
CN(C1=CC2=C(C(=C(C=C2)OC)OC)OC1=O)C(=O)C3=NO[C@H]4[C@@H](C=C[C@H]([C@]4(C3)O)O)O
|
|
InChI |
InChI=1S/C21H22N2O9/c1-23(12-8-10-4-6-14(29-2)17(30-3)16(10)31-20(12)27)19(26)11-9-21(28)15(25)7-5-13(24)18(21)32-22-11/h4-8,13,15,18,24-25,28H,9H2,1-3H3/t13-,15-,18+,21+/m1/s1
|
|
InChIKey |
PCMUPOUDXMFDRE-NYGSYELISA-N
|
|
Synonyms |
trichodermamide C; CHEMBL262328; DTXSID50894032; Q63398568; (4aS,5R,8R,8aS)-N-(7,8-dimethoxy-2-oxochromen-3-yl)-4a,5,8-trihydroxy-N-methyl-4,5,8,8a-tetrahydro-1,2-benzoxazine-3-carboxamide
|
|
CAS | NA | |
PubChem CID | 25067253 | |
ChEMBL ID | CHEMBL262328 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 446.4 | ALogp: | -0.4 |
HBD: | 3 | HBA: | 10 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 147.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 32 | QED Weighted: | 0.446 |
Caco-2 Permeability: | -5.284 | MDCK Permeability: | 0.00003710 |
Pgp-inhibitor: | 0.073 | Pgp-substrate: | 0.269 |
Human Intestinal Absorption (HIA): | 0.905 | 20% Bioavailability (F20%): | 0.894 |
30% Bioavailability (F30%): | 0.994 |
Blood-Brain-Barrier Penetration (BBB): | 0.605 | Plasma Protein Binding (PPB): | 56.80% |
Volume Distribution (VD): | 1.27 | Fu: | 28.54% |
CYP1A2-inhibitor: | 0.043 | CYP1A2-substrate: | 0.951 |
CYP2C19-inhibitor: | 0.027 | CYP2C19-substrate: | 0.392 |
CYP2C9-inhibitor: | 0.017 | CYP2C9-substrate: | 0.445 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.485 |
CYP3A4-inhibitor: | 0.072 | CYP3A4-substrate: | 0.162 |
Clearance (CL): | 1.719 | Half-life (T1/2): | 0.252 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.607 |
Drug-inuced Liver Injury (DILI): | 0.977 | AMES Toxicity: | 0.11 |
Rat Oral Acute Toxicity: | 0.162 | Maximum Recommended Daily Dose: | 0.036 |
Skin Sensitization: | 0.071 | Carcinogencity: | 0.116 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.098 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002091 | ![]() |
0.776 | D08SKH | ![]() |
0.288 | ||
ENC004309 | ![]() |
0.611 | D06GCK | ![]() |
0.287 | ||
ENC002347 | ![]() |
0.522 | D0L1JW | ![]() |
0.273 | ||
ENC003738 | ![]() |
0.417 | D03DIG | ![]() |
0.269 | ||
ENC003545 | ![]() |
0.411 | D0W8WB | ![]() |
0.268 | ||
ENC003540 | ![]() |
0.402 | D09DHY | ![]() |
0.263 | ||
ENC003539 | ![]() |
0.398 | D0G4KG | ![]() |
0.259 | ||
ENC003659 | ![]() |
0.398 | D0Q0PR | ![]() |
0.255 | ||
ENC004276 | ![]() |
0.381 | D0D4HN | ![]() |
0.254 | ||
ENC004283 | ![]() |
0.378 | D04TDQ | ![]() |
0.254 |