![]() |
Name |
6,8-di-O-methylnidurufin
|
Molecular Formula | C22H20O8 | |
IUPAC Name* |
(1R,17S,20S)-3,20-dihydroxy-7,9-dimethoxy-17-methyl-16,21-dioxapentacyclo[15.3.1.02,15.04,13.06,11]henicosa-2(15),3,6(11),7,9,13-hexaene-5,12-dione
|
|
SMILES |
C[C@]12CC[C@@H]([C@H](O1)C3=C(O2)C=C4C(=C3O)C(=O)C5=C(C4=O)C=C(C=C5OC)OC)O
|
|
InChI |
InChI=1S/C22H20O8/c1-22-5-4-12(23)21(30-22)17-14(29-22)8-11-16(20(17)26)19(25)15-10(18(11)24)6-9(27-2)7-13(15)28-3/h6-8,12,21,23,26H,4-5H2,1-3H3/t12-,21-,22+/m0/s1
|
|
InChIKey |
GJWLHYZAPSMRLW-LFYVKHLCSA-N
|
|
Synonyms |
6,8-di-O-methylnidurufin; JV4CL7JDL3; 6,8-Di-O-methylnidurufin-; 2,6-Epoxy-2H-anthra(2,3-b)oxocin-8,13-dione, 3,4,5,6-tetrahydro-5,7-dihydroxy-9,11-dimethoxy-2-methyl-, (2S,5S,6R)-; 60397-71-9; UNII-JV4CL7JDL3
|
|
CAS | 60397-71-9 | |
PubChem CID | 23256581 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 412.4 | ALogp: | 2.7 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 112.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 30 | QED Weighted: | 0.66 |
Caco-2 Permeability: | -4.926 | MDCK Permeability: | 0.00001840 |
Pgp-inhibitor: | 0.481 | Pgp-substrate: | 0.009 |
Human Intestinal Absorption (HIA): | 0.015 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.007 |
Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 90.99% |
Volume Distribution (VD): | 0.527 | Fu: | 12.00% |
CYP1A2-inhibitor: | 0.286 | CYP1A2-substrate: | 0.979 |
CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.825 |
CYP2C9-inhibitor: | 0.458 | CYP2C9-substrate: | 0.801 |
CYP2D6-inhibitor: | 0.114 | CYP2D6-substrate: | 0.354 |
CYP3A4-inhibitor: | 0.156 | CYP3A4-substrate: | 0.169 |
Clearance (CL): | 12.794 | Half-life (T1/2): | 0.525 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.407 |
Drug-inuced Liver Injury (DILI): | 0.963 | AMES Toxicity: | 0.564 |
Rat Oral Acute Toxicity: | 0.1 | Maximum Recommended Daily Dose: | 0.877 |
Skin Sensitization: | 0.872 | Carcinogencity: | 0.154 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.311 |
Respiratory Toxicity: | 0.367 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002273 | ![]() |
0.783 | D01XWG | ![]() |
0.338 | ||
ENC004539 | ![]() |
0.660 | D07VLY | ![]() |
0.322 | ||
ENC005076 | ![]() |
0.612 | D0C9XJ | ![]() |
0.322 | ||
ENC001429 | ![]() |
0.549 | D0T8EH | ![]() |
0.292 | ||
ENC003182 | ![]() |
0.534 | D0T5XN | ![]() |
0.288 | ||
ENC002434 | ![]() |
0.529 | D06GCK | ![]() |
0.288 | ||
ENC003228 | ![]() |
0.515 | D0C1SF | ![]() |
0.287 | ||
ENC005543 | ![]() |
0.500 | D0L1JW | ![]() |
0.283 | ||
ENC004746 | ![]() |
0.495 | D0D4HN | ![]() |
0.282 | ||
ENC001063 | ![]() |
0.477 | D04TDQ | ![]() |
0.282 |