|
Name |
Aversin
|
Molecular Formula | C20H16O7 | |
IUPAC Name* |
(4S,8R)-18-hydroxy-2,16-dimethoxy-7,9-dioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),11,14(19),15,17-hexaene-13,20-dione
|
|
SMILES |
COC1=CC2=C(C(=C1)O)C(=O)C3=C(C4=C(C=C3C2=O)O[C@@H]5[C@H]4CCO5)OC
|
|
InChI |
InChI=1S/C20H16O7/c1-24-8-5-10-14(12(21)6-8)18(23)16-11(17(10)22)7-13-15(19(16)25-2)9-3-4-26-20(9)27-13/h5-7,9,20-21H,3-4H2,1-2H3/t9-,20+/m0/s1
|
|
InChIKey |
RJMVOYLRGJZYAO-GWNMQOMSSA-N
|
|
Synonyms |
Aversin; (-)-Aversin; 34080-91-6; OCJ5M677TN; Anthra(2,3-b)furo(3,2-d)furan-5,10-dione, 2,3,3a,12a-tetrahydro-6-hydroxy-4,8-dimethoxy-, (3aS-cis)-; UNII-OCJ5M677TN; (3aS-cis)-2,3,3a,12a-Tetrahydro-6-hydroxy-4,8-dimethoxyanthra(2,3-b)furo(3,2-d)furan-5,10-dione; 2,3,3a,12a-Tetrahydro-6-hydroxy-4,8-dimethoxyanthra(2,3-b)furo(3,2-d)furan-5,10-dione (3aS-cis)-; (4S,8R)-18-hydroxy-2,16-dimethoxy-7,9-dioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),11,14(19),15,17-hexaene-13,20-dione; ANTHRA(2,3-B)FURO(3,2-D)FURAN-5,10-DIONE, 2,3,3A,12A-TETRAHYDRO-6-HYDROXY-4,8-DIMETHOXY-, (3AS,12AR)-
|
|
CAS | 34080-91-6 | |
PubChem CID | 22296216 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 368.3 | ALogp: | 3.0 |
HBD: | 1 | HBA: | 7 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 91.3 | Aromatic Rings: | 5 |
Heavy Atoms: | 27 | QED Weighted: | 0.743 |
Caco-2 Permeability: | -5.117 | MDCK Permeability: | 0.00001660 |
Pgp-inhibitor: | 0.767 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.05 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.001 | Plasma Protein Binding (PPB): | 88.50% |
Volume Distribution (VD): | 0.548 | Fu: | 23.64% |
CYP1A2-inhibitor: | 0.912 | CYP1A2-substrate: | 0.907 |
CYP2C19-inhibitor: | 0.305 | CYP2C19-substrate: | 0.106 |
CYP2C9-inhibitor: | 0.663 | CYP2C9-substrate: | 0.897 |
CYP2D6-inhibitor: | 0.114 | CYP2D6-substrate: | 0.825 |
CYP3A4-inhibitor: | 0.116 | CYP3A4-substrate: | 0.093 |
Clearance (CL): | 8.086 | Half-life (T1/2): | 0.423 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.253 |
Drug-inuced Liver Injury (DILI): | 0.96 | AMES Toxicity: | 0.514 |
Rat Oral Acute Toxicity: | 0.297 | Maximum Recommended Daily Dose: | 0.77 |
Skin Sensitization: | 0.872 | Carcinogencity: | 0.306 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.798 |
Respiratory Toxicity: | 0.349 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000843 | 0.659 | D0L1JW | 0.289 | ||||
ENC003823 | 0.587 | D04TDQ | 0.288 | ||||
ENC005076 | 0.557 | D06GCK | 0.283 | ||||
ENC004539 | 0.556 | D07MGA | 0.280 | ||||
ENC002439 | 0.529 | D0D4HN | 0.278 | ||||
ENC002273 | 0.524 | D0N1FS | 0.274 | ||||
ENC000966 | 0.517 | D0W8WB | 0.274 | ||||
ENC005490 | 0.516 | D01XWG | 0.270 | ||||
ENC000362 | 0.511 | D02LZB | 0.269 | ||||
ENC003228 | 0.505 | D09DHY | 0.268 |