![]() |
Name |
2,5,7-Trihydroxy-3,9-dimethoxy-2-methyl-3,4-dihydrotetracene-1,6,11-trione
|
Molecular Formula | C21H18O8 | |
IUPAC Name* |
2,5,7-trihydroxy-3,9-dimethoxy-2-methyl-3,4-dihydrotetracene-1,6,11-trione
|
|
SMILES |
CC1(C(CC2=C(C3=C(C=C2C1=O)C(=O)C4=C(C3=O)C(=CC(=C4)OC)O)O)OC)O
|
|
InChI |
InChI=1S/C21H18O8/c1-21(27)14(29-3)7-9-10(20(21)26)6-12-16(18(9)24)19(25)15-11(17(12)23)4-8(28-2)5-13(15)22/h4-6,14,22,24,27H,7H2,1-3H3
|
|
InChIKey |
FSVADHRKHABVDE-UHFFFAOYSA-N
|
|
Synonyms |
57847-75-3; NSC248611; 7-Deoxysteffimycinone; STEFFIMYCINONEDEOXY,7-; SCHEMBL16227269; DTXSID50330349; 2,5,7-trihydroxy-3,9-dimethoxy-2-methyl-3,4-dihydrotetracene-1,6,11-trione; NSC-248611
|
|
CAS | 57847-75-3 | |
PubChem CID | 429120 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 398.4 | ALogp: | 2.0 |
HBD: | 3 | HBA: | 8 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 130.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 29 | QED Weighted: | 0.597 |
Caco-2 Permeability: | -5.348 | MDCK Permeability: | 0.00000653 |
Pgp-inhibitor: | 0.051 | Pgp-substrate: | 0.017 |
Human Intestinal Absorption (HIA): | 0.431 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.055 |
Blood-Brain-Barrier Penetration (BBB): | 0.005 | Plasma Protein Binding (PPB): | 93.87% |
Volume Distribution (VD): | 0.649 | Fu: | 16.21% |
CYP1A2-inhibitor: | 0.792 | CYP1A2-substrate: | 0.954 |
CYP2C19-inhibitor: | 0.028 | CYP2C19-substrate: | 0.108 |
CYP2C9-inhibitor: | 0.385 | CYP2C9-substrate: | 0.47 |
CYP2D6-inhibitor: | 0.034 | CYP2D6-substrate: | 0.193 |
CYP3A4-inhibitor: | 0.209 | CYP3A4-substrate: | 0.21 |
Clearance (CL): | 3.82 | Half-life (T1/2): | 0.624 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.277 |
Drug-inuced Liver Injury (DILI): | 0.958 | AMES Toxicity: | 0.535 |
Rat Oral Acute Toxicity: | 0.039 | Maximum Recommended Daily Dose: | 0.844 |
Skin Sensitization: | 0.774 | Carcinogencity: | 0.082 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.434 |
Respiratory Toxicity: | 0.213 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005543 | ![]() |
0.750 | D01XWG | ![]() |
0.321 | ||
ENC005542 | ![]() |
0.736 | D07VLY | ![]() |
0.305 | ||
ENC000966 | ![]() |
0.593 | D0C9XJ | ![]() |
0.305 | ||
ENC003228 | ![]() |
0.589 | D07MGA | ![]() |
0.287 | ||
ENC005280 | ![]() |
0.558 | D01XDL | ![]() |
0.285 | ||
ENC005540 | ![]() |
0.541 | D0N1FS | ![]() |
0.280 | ||
ENC001932 | ![]() |
0.540 | D06GCK | ![]() |
0.278 | ||
ENC000362 | ![]() |
0.534 | D0T5XN | ![]() |
0.273 | ||
ENC004539 | ![]() |
0.529 | D0T8EH | ![]() |
0.269 | ||
ENC000336 | ![]() |
0.522 | D08NQZ | ![]() |
0.266 |