![]() |
Name |
3-Hydroxyfumiquinazoline A
|
Molecular Formula | C24H23N5O5 | |
IUPAC Name* |
(1R,4R)-4-[[(2S,3aS,4S)-4-hydroxy-2-methyl-1-oxo-3,3a-dihydro-2H-imidazo[1,2-a]indol-4-yl]methyl]-1-hydroxy-1-methyl-2,4-dihydropyrazino[2,1-b]quinazoline-3,6-dione
|
|
SMILES |
C[C@H]1C(=O)N2[C@H](N1)[C@@](C3=CC=CC=C32)(C[C@@H]4C(=O)N[C@](C5=NC6=CC=CC=C6C(=O)N45)(C)O)O
|
|
InChI |
InChI=1S/C24H23N5O5/c1-12-19(31)28-16-10-6-4-8-14(16)24(34,22(28)25-12)11-17-18(30)27-23(2,33)21-26-15-9-5-3-7-13(15)20(32)29(17)21/h3-10,12,17,22,25,33-34H,11H2,1-2H3,(H,27,30)/t12-,17+,22-,23+,24-/m0/s1
|
|
InChIKey |
QGTGJHYSECYMPA-QPPKQEJQSA-N
|
|
Synonyms |
CHEMBL2229121; 3-HYDROXYFUMIQUINAZOLINE A
|
|
CAS | NA | |
PubChem CID | 21593916 | |
ChEMBL ID | CHEMBL2229121 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 461.5 | ALogp: | -0.2 |
HBD: | 4 | HBA: | 7 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 135.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 34 | QED Weighted: | 0.438 |
Caco-2 Permeability: | -5.602 | MDCK Permeability: | 0.00001530 |
Pgp-inhibitor: | 0.171 | Pgp-substrate: | 0.116 |
Human Intestinal Absorption (HIA): | 0.027 | 20% Bioavailability (F20%): | 0.02 |
30% Bioavailability (F30%): | 0.009 |
Blood-Brain-Barrier Penetration (BBB): | 0.16 | Plasma Protein Binding (PPB): | 64.33% |
Volume Distribution (VD): | 1.159 | Fu: | 39.02% |
CYP1A2-inhibitor: | 0.025 | CYP1A2-substrate: | 0.379 |
CYP2C19-inhibitor: | 0.028 | CYP2C19-substrate: | 0.402 |
CYP2C9-inhibitor: | 0.067 | CYP2C9-substrate: | 0.285 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.128 |
CYP3A4-inhibitor: | 0.095 | CYP3A4-substrate: | 0.929 |
Clearance (CL): | 2.168 | Half-life (T1/2): | 0.355 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.916 |
Drug-inuced Liver Injury (DILI): | 0.98 | AMES Toxicity: | 0.018 |
Rat Oral Acute Toxicity: | 0.11 | Maximum Recommended Daily Dose: | 0.932 |
Skin Sensitization: | 0.192 | Carcinogencity: | 0.063 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
Respiratory Toxicity: | 0.642 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002127 | ![]() |
0.774 | D0V9WF | ![]() |
0.310 | ||
ENC001948 | ![]() |
0.593 | D02TJS | ![]() |
0.287 | ||
ENC003764 | ![]() |
0.589 | D0G9YH | ![]() |
0.287 | ||
ENC004162 | ![]() |
0.583 | D04VKS | ![]() |
0.281 | ||
ENC000977 | ![]() |
0.534 | D0J5YC | ![]() |
0.279 | ||
ENC003203 | ![]() |
0.521 | D01TSI | ![]() |
0.275 | ||
ENC003601 | ![]() |
0.485 | D0E4DW | ![]() |
0.271 | ||
ENC004645 | ![]() |
0.479 | D0QV5T | ![]() |
0.270 | ||
ENC003666 | ![]() |
0.466 | D0E3OF | ![]() |
0.270 | ||
ENC002357 | ![]() |
0.463 | D0B1FE | ![]() |
0.268 |