![]() |
Name |
Aniquinazoline B
|
Molecular Formula | C27H31N5O4 | |
IUPAC Name* |
(1R,4R)-4-[2-hydroxy-2-[(2R,4S)-5-oxo-1-phenyl-4-propan-2-ylimidazolidin-2-yl]propyl]-1-methyl-2,4-dihydro-1H-pyrazino[2,1-b]quinazoline-3,6-dione
|
|
SMILES |
C[C@@H]1C2=NC3=CC=CC=C3C(=O)N2[C@@H](C(=O)N1)CC(C)([C@@H]4N[C@H](C(=O)N4C5=CC=CC=C5)C(C)C)O
|
|
InChI |
InChI=1S/C27H31N5O4/c1-15(2)21-25(35)31(17-10-6-5-7-11-17)26(30-21)27(4,36)14-20-23(33)28-16(3)22-29-19-13-9-8-12-18(19)24(34)32(20)22/h5-13,15-16,20-21,26,30,36H,14H2,1-4H3,(H,28,33)/t16-,20-,21+,26-,27?/m1/s1
|
|
InChIKey |
PZCYVUJYVOAEFM-MJKJVAEFSA-N
|
|
Synonyms |
Aniquinazoline B
|
|
CAS | NA | |
PubChem CID | 139585730 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 489.6 | ALogp: | 2.3 |
HBD: | 3 | HBA: | 6 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 114.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 36 | QED Weighted: | 0.507 |
Caco-2 Permeability: | -5.382 | MDCK Permeability: | 0.00001300 |
Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.074 |
Human Intestinal Absorption (HIA): | 0.086 | 20% Bioavailability (F20%): | 0.026 |
30% Bioavailability (F30%): | 0.139 |
Blood-Brain-Barrier Penetration (BBB): | 0.041 | Plasma Protein Binding (PPB): | 69.44% |
Volume Distribution (VD): | 0.647 | Fu: | 26.46% |
CYP1A2-inhibitor: | 0.03 | CYP1A2-substrate: | 0.109 |
CYP2C19-inhibitor: | 0.166 | CYP2C19-substrate: | 0.668 |
CYP2C9-inhibitor: | 0.564 | CYP2C9-substrate: | 0.173 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.165 |
CYP3A4-inhibitor: | 0.789 | CYP3A4-substrate: | 0.899 |
Clearance (CL): | 3.089 | Half-life (T1/2): | 0.191 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.989 |
Drug-inuced Liver Injury (DILI): | 0.987 | AMES Toxicity: | 0.011 |
Rat Oral Acute Toxicity: | 0.012 | Maximum Recommended Daily Dose: | 0.843 |
Skin Sensitization: | 0.081 | Carcinogencity: | 0.041 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.439 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003764 | ![]() |
0.788 | D0B1FE | ![]() |
0.324 | ||
ENC003601 | ![]() |
0.583 | D07VHR | ![]() |
0.317 | ||
ENC002127 | ![]() |
0.582 | D0QV5T | ![]() |
0.301 | ||
ENC001979 | ![]() |
0.534 | D0E3OF | ![]() |
0.299 | ||
ENC005478 | ![]() |
0.534 | D0J6WW | ![]() |
0.293 | ||
ENC004267 | ![]() |
0.526 | D06ZPS | ![]() |
0.292 | ||
ENC003272 | ![]() |
0.509 | D03DEI | ![]() |
0.287 | ||
ENC004609 | ![]() |
0.479 | D08FTG | ![]() |
0.284 | ||
ENC002409 | ![]() |
0.466 | D0J5VR | ![]() |
0.284 | ||
ENC004647 | ![]() |
0.463 | D06IXT | ![]() |
0.281 |