![]() |
Name |
Tryptoquivaline F
|
Molecular Formula | C22H18N4O4 | |
IUPAC Name* |
(2S,3'R,3aR,4S)-2-methyl-3'-(4-oxoquinazolin-3-yl)spiro[3,3a-dihydro-2H-imidazo[1,2-a]indole-4,5'-oxolane]-1,2'-dione
|
|
SMILES |
C[C@H]1C(=O)N2[C@@H](N1)[C@]3(C[C@H](C(=O)O3)N4C=NC5=CC=CC=C5C4=O)C6=CC=CC=C62
|
|
InChI |
InChI=1S/C22H18N4O4/c1-12-18(27)26-16-9-5-3-7-14(16)22(21(26)24-12)10-17(20(29)30-22)25-11-23-15-8-4-2-6-13(15)19(25)28/h2-9,11-12,17,21,24H,10H2,1H3/t12-,17+,21+,22-/m0/s1
|
|
InChIKey |
ZVBIGFFAMBWOSA-RGKJGADRSA-N
|
|
Synonyms |
Tryptoquivaline F; Fumitremorgin F; SEZ763TO35; 61897-89-0; Tryptoquivaline J; UNII-SEZ763TO35; 19-EPIFUMITREMORGIN J; CHEMBL557488; 19-EPITRYPTOQUIVALINE J; DTXSID80216400; 66212-51-9; Q27289169; FTF; Spiro(furan-2(5H),9'-(9H)imidazo(1,2-a)indole)- 3',5(2'H)-dione, 1',3,4,9'a-tetrahydro-2'-methyl-4-(4-oxo-3(4H)-quinazolinyl)-, (2'S-(2'R,9'?S*),9'aR))-; SPIRO(FURAN-2(5H),9'-(9H)IMIDAZO(1,2-A)INDOLE)-3',5(2'H)-DIONE, 1',3,4,9'A-TETRAHYDRO-2'-METHYL-4-(4-OXO-3(4H)-QUINAZOLINYL)-, (2S,2'S,4R,9'AR)-; Spiro(furan-2(5H),9'-(9H)imidazo(1,2-a)indole)-3',5(2'H)-dione, 1',3,4,9'a-tetrahydro-2'-methyl-4-(4-oxo-3(4H)-quinazolinyl)-, (2S,2'S,4S,9'aR)-
|
|
CAS | 61897-89-0 | |
PubChem CID | 181786 | |
ChEMBL ID | CHEMBL557488 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 402.4 | ALogp: | 1.4 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 91.3 | Aromatic Rings: | 6 |
Heavy Atoms: | 30 | QED Weighted: | 0.626 |
Caco-2 Permeability: | -5.384 | MDCK Permeability: | 0.00002720 |
Pgp-inhibitor: | 0.601 | Pgp-substrate: | 0.059 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.835 |
30% Bioavailability (F30%): | 0.946 |
Blood-Brain-Barrier Penetration (BBB): | 0.093 | Plasma Protein Binding (PPB): | 48.85% |
Volume Distribution (VD): | 0.769 | Fu: | 61.88% |
CYP1A2-inhibitor: | 0.029 | CYP1A2-substrate: | 0.568 |
CYP2C19-inhibitor: | 0.062 | CYP2C19-substrate: | 0.694 |
CYP2C9-inhibitor: | 0.071 | CYP2C9-substrate: | 0.288 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.152 |
CYP3A4-inhibitor: | 0.31 | CYP3A4-substrate: | 0.928 |
Clearance (CL): | 3.824 | Half-life (T1/2): | 0.107 |
hERG Blockers: | 0.032 | Human Hepatotoxicity (H-HT): | 0.968 |
Drug-inuced Liver Injury (DILI): | 0.977 | AMES Toxicity: | 0.022 |
Rat Oral Acute Toxicity: | 0.046 | Maximum Recommended Daily Dose: | 0.907 |
Skin Sensitization: | 0.401 | Carcinogencity: | 0.082 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.279 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002868 | ![]() |
0.752 | D0B1FE | ![]() |
0.304 | ||
ENC003203 | ![]() |
0.703 | D0DV3O | ![]() |
0.303 | ||
ENC002357 | ![]() |
0.644 | D08FTG | ![]() |
0.298 | ||
ENC004162 | ![]() |
0.602 | D0QL3P | ![]() |
0.296 | ||
ENC003647 | ![]() |
0.600 | D0QV5T | ![]() |
0.292 | ||
ENC002127 | ![]() |
0.543 | D0E3OF | ![]() |
0.291 | ||
ENC002409 | ![]() |
0.534 | D07VHR | ![]() |
0.288 | ||
ENC001948 | ![]() |
0.492 | D05MQK | ![]() |
0.288 | ||
ENC003601 | ![]() |
0.438 | D07GXR | ![]() |
0.284 | ||
ENC003666 | ![]() |
0.398 | D0V9WF | ![]() |
0.284 |