|
Name |
cyclo(Leu-Leu)
|
Molecular Formula | C12H22N2O2 | |
IUPAC Name* |
(3R,6R)-3,6-bis(2-methylpropyl)piperazine-2,5-dione
|
|
SMILES |
CC(C)C[C@@H]1C(=O)N[C@@H](C(=O)N1)CC(C)C
|
|
InChI |
InChI=1S/C12H22N2O2/c1-7(2)5-9-11(15)14-10(6-8(3)4)12(16)13-9/h7-10H,5-6H2,1-4H3,(H,13,16)(H,14,15)/t9-,10-/m1/s1
|
|
InChIKey |
XWYXUMDVQIOAPR-NXEZZACHSA-N
|
|
Synonyms |
cyclo(Leu-Leu); Cyclo(D-Leu-D-Leu-); CHEMBL4574020; ZINC1763539
|
|
CAS | NA | |
PubChem CID | 12206395 | |
ChEMBL ID | CHEMBL4574020 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 226.32 | ALogp: | 2.1 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 58.2 | Aromatic Rings: | 1 |
Heavy Atoms: | 16 | QED Weighted: | 0.763 |
Caco-2 Permeability: | -4.591 | MDCK Permeability: | 0.00007600 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.021 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.797 | Plasma Protein Binding (PPB): | 36.03% |
Volume Distribution (VD): | 0.693 | Fu: | 42.52% |
CYP1A2-inhibitor: | 0.054 | CYP1A2-substrate: | 0.097 |
CYP2C19-inhibitor: | 0.177 | CYP2C19-substrate: | 0.49 |
CYP2C9-inhibitor: | 0.236 | CYP2C9-substrate: | 0.738 |
CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.189 |
CYP3A4-inhibitor: | 0.181 | CYP3A4-substrate: | 0.214 |
Clearance (CL): | 5.46 | Half-life (T1/2): | 0.556 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.425 |
Drug-inuced Liver Injury (DILI): | 0.114 | AMES Toxicity: | 0.072 |
Rat Oral Acute Toxicity: | 0.37 | Maximum Recommended Daily Dose: | 0.021 |
Skin Sensitization: | 0.096 | Carcinogencity: | 0.057 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.026 |
Respiratory Toxicity: | 0.045 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000990 | 1.000 | D0R6BR | 0.254 | ||||
ENC002257 | 0.617 | D05BQK | 0.235 | ||||
ENC001909 | 0.508 | D0A4JK | 0.227 | ||||
ENC001136 | 0.444 | D0F0YZ | 0.217 | ||||
ENC003254 | 0.400 | D00MYT | 0.217 | ||||
ENC005708 | 0.383 | D0W1QI | 0.213 | ||||
ENC005974 | 0.383 | D05TMQ | 0.209 | ||||
ENC001907 | 0.383 | D0P7VJ | 0.208 | ||||
ENC000904 | 0.377 | D0L7LC | 0.207 | ||||
ENC004530 | 0.373 | D05OQJ | 0.206 |