|
Name |
Carvone oxide
|
Molecular Formula | C10H14O2 | |
IUPAC Name* |
(1S,4R,6S)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-one
|
|
SMILES |
CC(=C)[C@@H]1C[C@H]2[C@](O2)(C(=O)C1)C
|
|
InChI |
InChI=1S/C10H14O2/c1-6(2)7-4-8(11)10(3)9(5-7)12-10/h7,9H,1,4-5H2,2-3H3/t7-,9-,10+/m0/s1
|
|
InChIKey |
YGMNGQDLUQECTO-UJNFCWOMSA-N
|
|
Synonyms |
18383-49-8; Carvone-5,6-oxide, cis-(-)-; Carvone oxide; Carvone oxide, cis-; (1S,4R,6S)-1-Methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptan-2-one; TV5341W478; (1S,4R,6S)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-one; cis-Carvone oxide; UNII-TV5341W478; 1,6-Epoxy-p-menth-8-en-2-one, (1S,4R,6S)-; cis-(-)-carvone-5,6-oxide; P-Menth-8-en-2-one, 1,6-epoxy-, (1S,4R6S)-; DTXSID60171487; L-(-)-CARVONE CIS-EPOXIDE; ZINC17027267; 1-Methyl-4-(1-methylethenyl)-7-oxabicyclo(4.1.0)heptan-2-one, (1S-(1alpha,4beta,6alpha))-; 7-Oxabicyclo(4.1.0)heptan-2-one, 1-methyl-4-(1-methylethenyl)-, (1S-(1alpha,4beta,6alpha))-; FEMA NO. 4084, CIS-(-)-; J3.555.750D; EN300-1608166; Q27290410; Z1513601121; P-MENTH-8-EN-2-ONE, 1,6-EPOXY-, (1S,4R,6S)-; (1S,6S)-1-Methyl-4alpha-isopropenyl-7-oxabicyclo[4.1.0]heptane-2-one; 7-OXABICYCLO(4.1.0)HEPTAN-2-ONE, 1-METHYL-4-(1-METHYLETHENYL)-, (1S,4R,6S)-; 7-OXABICYCLO(4.1.0)HEPTAN-2-ONE, 1-METHYL-4-(1-METHYLETHENYL)-, (1S-(1.ALPHA.,4.BETA.,6.ALPHA.))-
|
|
CAS | 18383-49-8 | |
PubChem CID | 11030188 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 166.22 | ALogp: | 1.6 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 29.6 | Aromatic Rings: | 2 |
Heavy Atoms: | 12 | QED Weighted: | 0.442 |
Caco-2 Permeability: | -4.545 | MDCK Permeability: | 0.00002270 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.015 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.013 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.934 | Plasma Protein Binding (PPB): | 48.00% |
Volume Distribution (VD): | 1.107 | Fu: | 63.61% |
CYP1A2-inhibitor: | 0.038 | CYP1A2-substrate: | 0.656 |
CYP2C19-inhibitor: | 0.037 | CYP2C19-substrate: | 0.853 |
CYP2C9-inhibitor: | 0.014 | CYP2C9-substrate: | 0.087 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.342 |
CYP3A4-inhibitor: | 0.047 | CYP3A4-substrate: | 0.384 |
Clearance (CL): | 14.039 | Half-life (T1/2): | 0.749 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.377 |
Drug-inuced Liver Injury (DILI): | 0.189 | AMES Toxicity: | 0.302 |
Rat Oral Acute Toxicity: | 0.384 | Maximum Recommended Daily Dose: | 0.851 |
Skin Sensitization: | 0.553 | Carcinogencity: | 0.921 |
Eye Corrosion: | 0.984 | Eye Irritation: | 0.989 |
Respiratory Toxicity: | 0.968 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000567 | 0.386 | D0H1QY | 0.245 | ||||
ENC000194 | 0.356 | D0H0BG | 0.203 | ||||
ENC003099 | 0.322 | D0A2AJ | 0.188 | ||||
ENC002219 | 0.311 | D0D2VS | 0.177 | ||||
ENC002272 | 0.305 | D0K7LU | 0.174 | ||||
ENC001836 | 0.304 | D0S3WH | 0.173 | ||||
ENC001079 | 0.304 | D0H6VY | 0.172 | ||||
ENC002073 | 0.304 | D0K0EK | 0.167 | ||||
ENC000332 | 0.304 | D0W2EK | 0.167 | ||||
ENC000411 | 0.298 | D0V8HA | 0.164 |