|
Name |
Dihydrocarvone
|
Molecular Formula | C10H16O | |
IUPAC Name* |
2-methyl-5-prop-1-en-2-ylcyclohexan-1-one
|
|
SMILES |
CC1CCC(CC1=O)C(=C)C
|
|
InChI |
InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3
|
|
InChIKey |
AZOCECCLWFDTAP-UHFFFAOYSA-N
|
|
Synonyms |
Dihydrocarvone; 7764-50-3; (+)-Dihydrocarvone; p-Menth-8-en-2-one; 1,6-Dihydrocarvone; 2-METHYL-5-(1-METHYLETHENYL)CYCLOHEXANONE; 2-methyl-5-prop-1-en-2-ylcyclohexan-1-one; 2-Methyl-5-(Prop-1-En-2-Yl)Cyclohexan-1-One; 8-p-Menthen-2-one; d-Dihydrocarvone; Cyclohexanone, 2-methyl-5-(1-methylethenyl)-; 2-Methyl-5-(1-methylvinyl)cyclohexan-1-one; p-Menth-8(9)-en-2-one; Menth-8-en-2-one; 2-methyl-5-isopropenylcyclohexanone; 5-Isopropenyl-2-methylcyclohexanone; 2-methyl-5-(prop-1-en-2-yl)cyclohexanone; 5948-04-9; EINECS 231-857-0; UNII-YQS5CW1O1J; a dihydrocarvone; an isodihydrocarvone; dextro-dihydrocarvone; Dihydrocarvone, (+)-; 2-Methyl-5-(1-methylethenyl)-Cyclohexanone; YQS5CW1O1J; Cyclohexanone, 2-methyl-5-(1-methylethenyl)-, (2R,5R)-rel-; SCHEMBL309206; (+)-p-Menth-8-en-2-one; CHEBI:23733; FEMA 3565; DTXSID00863556; 3-isopropenyl-6-methylcyclohexanone; BCP30885; MFCD00001636; 5-Isopropenyl-2-methylcyclohexanone #; AKOS015907251; LS-13847; DB-071963; CS-0031698; FT-0624469; FT-0773968; Cyclohexanone,2-methyl-5-(1-methylethenyl)-; C18018; E76541; 2-Methyl-5-(1-methylethenyl)cyclohexanone, 9CI; W-104306; Q27109809; (Z)-dihydrocarvone,cis-2-methyl-5-(1-methylethenyl)-cyclohexanone,cis-p-menth-8-en-2-one
|
|
CAS | 7764-50-3 | |
PubChem CID | 24473 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 152.23 | ALogp: | 2.7 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 1 |
Heavy Atoms: | 11 | QED Weighted: | 0.526 |
Caco-2 Permeability: | -4.384 | MDCK Permeability: | 0.00002460 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.193 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.984 | Plasma Protein Binding (PPB): | 53.97% |
Volume Distribution (VD): | 1.038 | Fu: | 40.20% |
CYP1A2-inhibitor: | 0.121 | CYP1A2-substrate: | 0.762 |
CYP2C19-inhibitor: | 0.047 | CYP2C19-substrate: | 0.851 |
CYP2C9-inhibitor: | 0.025 | CYP2C9-substrate: | 0.569 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.896 |
CYP3A4-inhibitor: | 0.033 | CYP3A4-substrate: | 0.321 |
Clearance (CL): | 13.904 | Half-life (T1/2): | 0.723 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.433 |
Drug-inuced Liver Injury (DILI): | 0.182 | AMES Toxicity: | 0.037 |
Rat Oral Acute Toxicity: | 0.052 | Maximum Recommended Daily Dose: | 0.168 |
Skin Sensitization: | 0.084 | Carcinogencity: | 0.77 |
Eye Corrosion: | 0.373 | Eye Irritation: | 0.891 |
Respiratory Toxicity: | 0.463 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001619 | 0.489 | D0H1QY | 0.234 | ||||
ENC000839 | 0.489 | D05HXX | 0.229 | ||||
ENC000411 | 0.450 | D09NNA | 0.217 | ||||
ENC002219 | 0.436 | D0R7WU | 0.212 | ||||
ENC002100 | 0.386 | D04CSZ | 0.208 | ||||
ENC000194 | 0.381 | D04SFH | 0.198 | ||||
ENC001066 | 0.366 | D0I2SD | 0.198 | ||||
ENC000555 | 0.366 | D0B5LF | 0.194 | ||||
ENC001816 | 0.349 | D0Z8SF | 0.191 | ||||
ENC001284 | 0.349 | D0D2VS | 0.184 |