|
Name |
Prehelminthosporol
|
Molecular Formula | C15H24O2 | |
IUPAC Name* |
1-methyl-2-methylidene-9-propan-2-yl-5-oxatricyclo[5.4.0.03,8]undecan-4-ol
|
|
SMILES |
CC(C)C1CCC2(C3C1C(C2=C)C(OC3)O)C
|
|
InChI |
InChI=1S/C15H24O2/c1-8(2)10-5-6-15(4)9(3)12-13(10)11(15)7-17-14(12)16/h8,10-14,16H,3,5-7H2,1-2,4H3
|
|
InChIKey |
RVFULFDTCDRKNZ-UHFFFAOYSA-N
|
|
Synonyms |
Prehelminthosporol; 1619-13-2; 1-methyl-2-methylidene-9-propan-2-yl-5-oxatricyclo[5.4.0.03,8]undecan-4-ol; Octahydro-8-methyl-9-methylene-5-isopropyl-4,8-methano-1H-2-benzopyran-3-ol; SCHEMBL9823994; DTXSID80936611; 4,8-Methano-1H-2-benzopyran-3-ol, octahydro-8-methyl-9-methylene-5-(1-methylethyl)-; 1-methyl-2-methylidene-9-(propan-2-yl)-5-oxatricyclo[5.4.0.0?,?]undecan-4-ol; 8-Methyl-9-methylidene-5-(propan-2-yl)octahydro-1H-4,8-methano-2-benzopyran-3-ol
|
|
CAS | 1619-13-2 | |
PubChem CID | 6451296 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 236.35 | ALogp: | 3.2 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 29.5 | Aromatic Rings: | 3 |
Heavy Atoms: | 17 | QED Weighted: | 0.705 |
Caco-2 Permeability: | -4.585 | MDCK Permeability: | 0.00002920 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.88 | Plasma Protein Binding (PPB): | 78.99% |
Volume Distribution (VD): | 1.401 | Fu: | 19.67% |
CYP1A2-inhibitor: | 0.026 | CYP1A2-substrate: | 0.643 |
CYP2C19-inhibitor: | 0.016 | CYP2C19-substrate: | 0.936 |
CYP2C9-inhibitor: | 0.051 | CYP2C9-substrate: | 0.072 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.32 |
CYP3A4-inhibitor: | 0.047 | CYP3A4-substrate: | 0.453 |
Clearance (CL): | 8.821 | Half-life (T1/2): | 0.073 |
hERG Blockers: | 0.022 | Human Hepatotoxicity (H-HT): | 0.256 |
Drug-inuced Liver Injury (DILI): | 0.047 | AMES Toxicity: | 0.03 |
Rat Oral Acute Toxicity: | 0.616 | Maximum Recommended Daily Dose: | 0.424 |
Skin Sensitization: | 0.046 | Carcinogencity: | 0.089 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.02 |
Respiratory Toxicity: | 0.771 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005456 | 0.727 | D04CSZ | 0.316 | ||||
ENC001293 | 0.607 | D0N6FH | 0.244 | ||||
ENC004835 | 0.586 | D0B4RU | 0.236 | ||||
ENC002277 | 0.586 | D0Y7LD | 0.229 | ||||
ENC000976 | 0.485 | D0K0EK | 0.221 | ||||
ENC003488 | 0.468 | D0S3WH | 0.214 | ||||
ENC002553 | 0.450 | D04SFH | 0.213 | ||||
ENC005457 | 0.412 | D04VIS | 0.213 | ||||
ENC001140 | 0.403 | D0G5CF | 0.208 | ||||
ENC000535 | 0.403 | D08SVH | 0.208 |