![]() |
Name |
bipolenin E
|
Molecular Formula | C30H46O3 | |
IUPAC Name* |
8-methyl-7-methylidene-5-[(8-methyl-7-methylidene-11-propan-2-yl-4-oxatricyclo[4.4.0.02,8]decan-5-yl)oxy]-11-propan-2-yl-4-oxatricyclo[4.4.0.02,8]decane
|
|
SMILES |
C=C1C2C(OC3OCC4C5C(C(C)C)CCC4(C)C(=C)C35)OCC3C2C(C(C)C)CCC13C
|
|
InChI |
InChI=1S/C30H46O3/c1-15(2)19-9-11-29(7)17(5)23-25(19)21(29)13-31-27(23)33-28-24-18(6)30(8)12-10-20(16(3)4)26(24)22(30)14-32-28/h15-16,19-28H,5-6,9-14H2,1-4,7-8H3/t19-,20-,21+,22+,23+,24+,25+,26+,27+,28+,29+,30+/m1/s1
|
|
InChIKey |
LHZNEOPIRSAFPQ-GYJWKJBHSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 454.7 | ALogp: | 6.7 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 27.7 | Aromatic Rings: | 6 |
Heavy Atoms: | 33 | QED Weighted: | 0.446 |
Caco-2 Permeability: | -4.927 | MDCK Permeability: | 0.00002070 |
Pgp-inhibitor: | 0.259 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.494 |
Blood-Brain-Barrier Penetration (BBB): | 0.354 | Plasma Protein Binding (PPB): | 97.48% |
Volume Distribution (VD): | 2.523 | Fu: | 2.83% |
CYP1A2-inhibitor: | 0.005 | CYP1A2-substrate: | 0.714 |
CYP2C19-inhibitor: | 0.04 | CYP2C19-substrate: | 0.97 |
CYP2C9-inhibitor: | 0.077 | CYP2C9-substrate: | 0.025 |
CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.159 |
CYP3A4-inhibitor: | 0.162 | CYP3A4-substrate: | 0.806 |
Clearance (CL): | 3.802 | Half-life (T1/2): | 0.001 |
hERG Blockers: | 0.056 | Human Hepatotoxicity (H-HT): | 0.161 |
Drug-inuced Liver Injury (DILI): | 0.073 | AMES Toxicity: | 0.092 |
Rat Oral Acute Toxicity: | 0.911 | Maximum Recommended Daily Dose: | 0.716 |
Skin Sensitization: | 0.012 | Carcinogencity: | 0.074 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.015 |
Respiratory Toxicity: | 0.652 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005456 | ![]() |
0.474 | D0Y7LD | ![]() |
0.252 | ||
ENC001878 | ![]() |
0.412 | D0K0EK | ![]() |
0.230 | ||
ENC001293 | ![]() |
0.364 | D0M4WA | ![]() |
0.218 | ||
ENC004835 | ![]() |
0.343 | D0B4RU | ![]() |
0.211 | ||
ENC002277 | ![]() |
0.343 | D0G8BV | ![]() |
0.211 | ||
ENC005681 | ![]() |
0.322 | D0G5CF | ![]() |
0.210 | ||
ENC005682 | ![]() |
0.318 | D0Z4ZT | ![]() |
0.209 | ||
ENC000976 | ![]() |
0.288 | D03ZTE | ![]() |
0.209 | ||
ENC001140 | ![]() |
0.282 | D0G3SH | ![]() |
0.209 | ||
ENC002553 | ![]() |
0.282 | D06CNP | ![]() |
0.208 |