![]() |
Name |
Dehydroxypaxilline
|
Molecular Formula | C27H33NO3 | |
IUPAC Name* |
(1S,2S,5S,7R,11R,14S)-7-(2-hydroxypropan-2-yl)-1,2-dimethyl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-9,16(24),17,19,21-pentaen-8-one
|
|
SMILES |
C[C@]12CC[C@H]3C(=CC(=O)[C@H](O3)C(C)(C)O)[C@@H]1CC[C@@H]4[C@@]2(C5=C(C4)C6=CC=CC=C6N5)C
|
|
InChI |
InChI=1S/C27H33NO3/c1-25(2,30)24-21(29)14-18-19-10-9-15-13-17-16-7-5-6-8-20(16)28-23(17)27(15,4)26(19,3)12-11-22(18)31-24/h5-8,14-15,19,22,24,28,30H,9-13H2,1-4H3/t15-,19-,22-,24-,26-,27+/m0/s1
|
|
InChIKey |
GYSZYWSJZCKCBD-LXGUAGHKSA-N
|
|
Synonyms |
13-Desoxypaxilline; DEHYDROXYPAXILLINE; 13-Deoxypaxilline; 13-dehydroxypaxilline; CHEMBL2408948; CHEBI:187070; DTXSID901099217; C20531; (1S,2S,5S,7R,11R,14S)-7-(2-hydroxypropan-2-yl)-1,2-dimethyl-6-oxa-23-azahexacyclo[12.10.0.02,11.05,10.016,24.017,22]tetracosa-9,16(24),17,19,21-pentaen-8-one; (2R,4bR,6aS,12bS,12cS,14aS)-5,6,6a,7,12,12b,12c,13,14,14a-Decahydro-2-(1-hydroxy-1-methylethyl)-12b,12c-dimethyl-2H-1-benzopyrano[5',6':6,7]indeno[1,2-b]indol-3(4bH)-one; 112900-05-7
|
|
CAS | 112900-05-7 | |
PubChem CID | 14166134 | |
ChEMBL ID | CHEMBL2408948 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 419.6 | ALogp: | 4.9 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 62.3 | Aromatic Rings: | 6 |
Heavy Atoms: | 31 | QED Weighted: | 0.665 |
Caco-2 Permeability: | -4.951 | MDCK Permeability: | 0.00002710 |
Pgp-inhibitor: | 0.841 | Pgp-substrate: | 0.64 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.012 |
30% Bioavailability (F30%): | 0.933 |
Blood-Brain-Barrier Penetration (BBB): | 0.865 | Plasma Protein Binding (PPB): | 94.96% |
Volume Distribution (VD): | 0.854 | Fu: | 2.51% |
CYP1A2-inhibitor: | 0.246 | CYP1A2-substrate: | 0.611 |
CYP2C19-inhibitor: | 0.337 | CYP2C19-substrate: | 0.681 |
CYP2C9-inhibitor: | 0.641 | CYP2C9-substrate: | 0.258 |
CYP2D6-inhibitor: | 0.24 | CYP2D6-substrate: | 0.138 |
CYP3A4-inhibitor: | 0.95 | CYP3A4-substrate: | 0.798 |
Clearance (CL): | 7.357 | Half-life (T1/2): | 0.2 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.245 |
Drug-inuced Liver Injury (DILI): | 0.534 | AMES Toxicity: | 0.221 |
Rat Oral Acute Toxicity: | 0.915 | Maximum Recommended Daily Dose: | 0.896 |
Skin Sensitization: | 0.759 | Carcinogencity: | 0.847 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.017 |
Respiratory Toxicity: | 0.985 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002951 | ![]() |
0.773 | D01JGV | ![]() |
0.296 | ||
ENC005989 | ![]() |
0.758 | D0U7GP | ![]() |
0.296 | ||
ENC003172 | ![]() |
0.758 | D0H4JM | ![]() |
0.296 | ||
ENC005990 | ![]() |
0.725 | D05MQK | ![]() |
0.267 | ||
ENC000836 | ![]() |
0.709 | D0V4WD | ![]() |
0.257 | ||
ENC005988 | ![]() |
0.705 | D0U3GL | ![]() |
0.254 | ||
ENC005406 | ![]() |
0.673 | D0K0KH | ![]() |
0.254 | ||
ENC005405 | ![]() |
0.670 | D00YLW | ![]() |
0.246 | ||
ENC001492 | ![]() |
0.600 | D06AEO | ![]() |
0.244 | ||
ENC000857 | ![]() |
0.596 | D0Q6NZ | ![]() |
0.244 |