![]() |
Name |
1,3-Di-tert-butylbenzene
|
Molecular Formula | C14H22 | |
IUPAC Name* |
1,3-ditert-butylbenzene
|
|
SMILES |
CC(C)(C)C1=CC(=CC=C1)C(C)(C)C
|
|
InChI |
InChI=1S/C14H22/c1-13(2,3)11-8-7-9-12(10-11)14(4,5)6/h7-10H,1-6H3
|
|
InChIKey |
ILNDSSCEZZFNGE-UHFFFAOYSA-N
|
|
Synonyms |
1,3-Di-tert-butylbenzene; 1014-60-4; Benzene, 1,3-bis(1,1-dimethylethyl)-; 1,3-ditert-butylbenzene; Benzene, m-di-tert-butyl-; m-Di-tert-butylbenzene; 1,3-di-t-butylbenzene; 1,3-bis(1,1-dimethylethyl)benzene; NSC243654; 1,3-ditert-butyl-benzene; 1,3-Ditertiarybutylbenzene; 1,3-di-tert-butyl benzene; 1,3-di-tert-butyl-benzene; CHEBI:88865; DTXSID80143904; 1,3-Di-tert-butylbenzene, 97%; BAA01460; ZINC1764611; Benzene,3-bis(1,1-dimethylethyl)-; MFCD00008830; AKOS015889123; NSC 243654; NSC-243654; AS-62564; CS-0154912; D2431; FT-0708280; C71072; J-000394; Q27160875
|
|
CAS | 1014-60-4 | |
PubChem CID | 136810 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 190.32 | ALogp: | 5.8 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 14 | QED Weighted: | 0.549 |
Caco-2 Permeability: | -4.982 | MDCK Permeability: | 0.00000862 |
Pgp-inhibitor: | 0.572 | Pgp-substrate: | 0.013 |
Human Intestinal Absorption (HIA): | 0.253 | 20% Bioavailability (F20%): | 0.924 |
30% Bioavailability (F30%): | 0.978 |
Blood-Brain-Barrier Penetration (BBB): | 0.168 | Plasma Protein Binding (PPB): | 98.78% |
Volume Distribution (VD): | 3.341 | Fu: | 4.21% |
CYP1A2-inhibitor: | 0.91 | CYP1A2-substrate: | 0.894 |
CYP2C19-inhibitor: | 0.813 | CYP2C19-substrate: | 0.835 |
CYP2C9-inhibitor: | 0.714 | CYP2C9-substrate: | 0.726 |
CYP2D6-inhibitor: | 0.844 | CYP2D6-substrate: | 0.408 |
CYP3A4-inhibitor: | 0.504 | CYP3A4-substrate: | 0.669 |
Clearance (CL): | 5.358 | Half-life (T1/2): | 0.135 |
hERG Blockers: | 0.037 | Human Hepatotoxicity (H-HT): | 0.045 |
Drug-inuced Liver Injury (DILI): | 0.058 | AMES Toxicity: | 0.002 |
Rat Oral Acute Toxicity: | 0.102 | Maximum Recommended Daily Dose: | 0.382 |
Skin Sensitization: | 0.467 | Carcinogencity: | 0.029 |
Eye Corrosion: | 0.982 | Eye Irritation: | 0.99 |
Respiratory Toxicity: | 0.096 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005113 | ![]() |
0.574 | D06YPU | ![]() |
0.339 | ||
ENC000185 | ![]() |
0.574 | D0X4ZR | ![]() |
0.322 | ||
ENC000695 | ![]() |
0.574 | D0W7WC | ![]() |
0.295 | ||
ENC000744 | ![]() |
0.574 | D00NJL | ![]() |
0.282 | ||
ENC000394 | ![]() |
0.548 | D02LTL | ![]() |
0.280 | ||
ENC000611 | ![]() |
0.510 | D01JFT | ![]() |
0.278 | ||
ENC001392 | ![]() |
0.417 | D0W0BF | ![]() |
0.263 | ||
ENC001398 | ![]() |
0.397 | D0S5LH | ![]() |
0.259 | ||
ENC000309 | ![]() |
0.389 | D08USJ | ![]() |
0.258 | ||
ENC000346 | ![]() |
0.382 | D0G1OZ | ![]() |
0.255 |