![]() |
Name |
Chetoseminudin E
|
Molecular Formula | C16H19N3O4S | |
IUPAC Name* |
3-hydroxy-6-(hydroxymethyl)-3-(1H-indol-3-ylmethyl)-1-methyl-6-methylsulfanylpiperazine-2,5-dione
|
|
SMILES |
CSC1(CO)C(=O)NC(O)(Cc2c[nH]c3ccccc23)C(=O)N1C
|
|
InChI |
InChI=1S/C16H19N3O4S/c1-19-14(22)15(23,18-13(21)16(19,9-20)24-2)7-10-8-17-12-6-4-3-5-11(10)12/h3-6,8,17,20,23H,7,9H2,1-2H3,(H,18,21)/t15-,16+/m0/s1
|
|
InChIKey |
IKOGFAWLNUZSIT-JKSUJKDBSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 349.41 | ALogp: | 0.0 |
HBD: | 4 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 105.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 24 | QED Weighted: | 0.641 |
Caco-2 Permeability: | -4.813 | MDCK Permeability: | 0.00001360 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.018 |
Human Intestinal Absorption (HIA): | 0.03 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.981 | Plasma Protein Binding (PPB): | 58.79% |
Volume Distribution (VD): | 0.899 | Fu: | 51.68% |
CYP1A2-inhibitor: | 0.057 | CYP1A2-substrate: | 0.899 |
CYP2C19-inhibitor: | 0.548 | CYP2C19-substrate: | 0.852 |
CYP2C9-inhibitor: | 0.324 | CYP2C9-substrate: | 0.474 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.103 |
CYP3A4-inhibitor: | 0.228 | CYP3A4-substrate: | 0.951 |
Clearance (CL): | 3.398 | Half-life (T1/2): | 0.437 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.141 |
Drug-inuced Liver Injury (DILI): | 0.944 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.541 | Maximum Recommended Daily Dose: | 0.045 |
Skin Sensitization: | 0.067 | Carcinogencity: | 0.047 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
Respiratory Toxicity: | 0.006 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004868 | ![]() |
0.585 | D05EJG | ![]() |
0.367 | ||
ENC004870 | ![]() |
0.583 | D07RGW | ![]() |
0.325 | ||
ENC005917 | ![]() |
0.565 | D08UMH | ![]() |
0.322 | ||
ENC004345 | ![]() |
0.565 | D08EOD | ![]() |
0.289 | ||
ENC004344 | ![]() |
0.565 | D02DMQ | ![]() |
0.286 | ||
ENC004343 | ![]() |
0.565 | D0Y7RW | ![]() |
0.284 | ||
ENC004342 | ![]() |
0.565 | D0U5RT | ![]() |
0.276 | ||
ENC005916 | ![]() |
0.565 | D0W7WC | ![]() |
0.274 | ||
ENC003991 | ![]() |
0.529 | D0NG7O | ![]() |
0.273 | ||
ENC004847 | ![]() |
0.529 | D0K0KH | ![]() |
0.270 |