![]() |
Name |
Pentane-2,3-diol
|
Molecular Formula | C5H12O2 | |
IUPAC Name* |
pentane-2,3-diol
|
|
SMILES |
CCC(C(C)O)O
|
|
InChI |
InChI=1S/C5H12O2/c1-3-5(7)4(2)6/h4-7H,3H2,1-2H3
|
|
InChIKey |
XLMFDCKSFJWJTP-UHFFFAOYSA-N
|
|
Synonyms |
Pentane-2,3-diol; 2,3-Pentanediol; 42027-23-6; EINECS 255-632-1; SCHEMBL37839; DTXSID20871390; MFCD00474530; AKOS022504354; AS-56713; CS-0243433; D93064; EN300-263649; Z1251352132
|
|
CAS | 42027-23-6 | |
PubChem CID | 123505 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 104.15 | ALogp: | 0.3 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 0 |
Heavy Atoms: | 7 | QED Weighted: | 0.536 |
Caco-2 Permeability: | -4.49 | MDCK Permeability: | 0.00026069 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.031 |
Human Intestinal Absorption (HIA): | 0.015 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.008 |
Blood-Brain-Barrier Penetration (BBB): | 0.341 | Plasma Protein Binding (PPB): | 10.15% |
Volume Distribution (VD): | 1.121 | Fu: | 74.97% |
CYP1A2-inhibitor: | 0.047 | CYP1A2-substrate: | 0.452 |
CYP2C19-inhibitor: | 0.017 | CYP2C19-substrate: | 0.745 |
CYP2C9-inhibitor: | 0.003 | CYP2C9-substrate: | 0.642 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.376 |
CYP3A4-inhibitor: | 0.003 | CYP3A4-substrate: | 0.183 |
Clearance (CL): | 7.577 | Half-life (T1/2): | 0.758 |
hERG Blockers: | 0.019 | Human Hepatotoxicity (H-HT): | 0.026 |
Drug-inuced Liver Injury (DILI): | 0.047 | AMES Toxicity: | 0.033 |
Rat Oral Acute Toxicity: | 0.041 | Maximum Recommended Daily Dose: | 0.012 |
Skin Sensitization: | 0.067 | Carcinogencity: | 0.031 |
Eye Corrosion: | 0.014 | Eye Irritation: | 0.814 |
Respiratory Toxicity: | 0.047 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000016 | ![]() |
0.500 | D08QGD | ![]() |
0.240 | ||
ENC001011 | ![]() |
0.500 | D0ZK8H | ![]() |
0.233 | ||
ENC000889 | ![]() |
0.364 | D08HUC | ![]() |
0.216 | ||
ENC005106 | ![]() |
0.342 | D04YPN | ![]() |
0.213 | ||
ENC000057 | ![]() |
0.333 | D00AMQ | ![]() |
0.211 | ||
ENC000307 | ![]() |
0.333 | D09MXS | ![]() |
0.205 | ||
ENC001474 | ![]() |
0.333 | D06HZY | ![]() |
0.205 | ||
ENC000289 | ![]() |
0.308 | D0P7EK | ![]() |
0.205 | ||
ENC000141 | ![]() |
0.300 | D08QME | ![]() |
0.196 | ||
ENC000396 | ![]() |
0.296 | D00ZOF | ![]() |
0.192 |