![]() |
Name |
(R,R)-2,3-butanediol
|
Molecular Formula | C4H10O2 | |
IUPAC Name* |
(2R,3R)-butane-2,3-diol
|
|
SMILES |
C[C@H]([C@@H](C)O)O
|
|
InChI |
InChI=1S/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3/t3-,4-/m1/s1
|
|
InChIKey |
OWBTYPJTUOEWEK-QWWZWVQMSA-N
|
|
Synonyms |
24347-58-8; (2R,3R)-butane-2,3-diol; (R,R)-2,3-butanediol; (2R,3R)-(-)-2,3-Butanediol; (R,R)-Butane-2,3-diol; 2,3-Butanediol, (-)-; (2R,3R)-2,3-butanediol; 6982-25-8; (R,R)-(-)-2,3-Butanediol; D-(-)-2,3-Butanediol; (R,R)-(-)-Butane-2,3-diol; Levo-2,3-Butanediol; (R,R)-2,3-Butylene glycol; 2,3-Butanediol, threo-; (R,R)-(-)-2,3-Butylene Glycol; (-)-2,3-butanediol; DL-2,3-Butanediol; (-)-(2R,3R)-Butanediol; 6510BGK6C5; OR02B2286A; 2,3-Butanediol, [R-(R*,R*)]-; 2,3-Butanediol #; BU3; 2,3-BUTANEDIOL, (R-(R*,R*))-; 2,3-Butanediol, (R*,R*)-(+-)-; UNII-6510BGK6C5; UNII-OR02B2286A; MFCD00064267; NSC-249246; (2R,3R)-rel-2,3-Butanediol; EINECS 246-186-9; (2r,3r)-butanediol; (r,r)-2,3 butanediol; D(-)-2,3-butanediol; D-2,3-BUTANEDIOL; L-(-)-2,3-Butanediol; THREO-2,3-BUTANEDIOL; (-)-(r,r)-2,3-butanediol; CHEBI:16982; rel-(2R,3R)-2,3-Butanediol; 2,3-Butanediol, (R*,R*)-; DTXSID801026532; DTXSID801031371; ZINC901616; NSC15829; (+/-)-2,3-BUTANEDIOL; (2R,3R)-(-)-2,3-butandiol; (R,R)-(-)-2,3-Dihydroxybutane; (2R, 3R)(-)-2,3-butanediol; BBL101946; NSC-15829; s3333; STL555743; (2R, 3R)-(-)-2,3-butanediol; AKOS015907648; AKOS016015450; CS-W016670; HY-W015954; 2,3-BUTANEDIOL, (+/-)-; 2,3-BUTANEDIOL, (2R,3R)-; AC-26496; AS-57289; BP-30189; 2,3-BUTANEDIOL, (2R,3R)-REL-; 2,3-BUTYLENE GLYCOL DL-THREO-FORM; (-)-(2R,3R)-2,3-BUTANEDIOL; DB-009316; (2R,3R)-(-)-2,3-Butanediol, 97%; B1161; 2,3-BUTANEDIOL, (2R,3R)-(-)-; 2,3-BUTYLENE GLYCOL D(-)-THREO-FORM; C03044; C91323; EN300-141851; 2,3-BUTANEDIOL, (R*,R*)-(+/-)-; 2,3-BUTYLENE GLYCOL DL-THREO-FORM [MI]; 347B588; A817243; 2,3-BUTYLENE GLYCOL D(-)-THREO-FORM [MI]; J-500969; J-506903; (2R,3R)-butane-2,3-diol;(2R,3R)-2,3-Butanediol; Q27102161
|
|
CAS | 24347-58-8 | |
PubChem CID | 225936 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 90.12 | ALogp: | -0.9 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 0 |
Heavy Atoms: | 6 | QED Weighted: | 0.482 |
Caco-2 Permeability: | -4.707 | MDCK Permeability: | 0.00069846 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.14 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.007 |
Blood-Brain-Barrier Penetration (BBB): | 0.238 | Plasma Protein Binding (PPB): | 13.50% |
Volume Distribution (VD): | 0.919 | Fu: | 81.93% |
CYP1A2-inhibitor: | 0.074 | CYP1A2-substrate: | 0.561 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.821 |
CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.734 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.317 |
CYP3A4-inhibitor: | 0.003 | CYP3A4-substrate: | 0.126 |
Clearance (CL): | 4.552 | Half-life (T1/2): | 0.813 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.026 |
Drug-inuced Liver Injury (DILI): | 0.061 | AMES Toxicity: | 0.014 |
Rat Oral Acute Toxicity: | 0.013 | Maximum Recommended Daily Dose: | 0.019 |
Skin Sensitization: | 0.061 | Carcinogencity: | 0.026 |
Eye Corrosion: | 0.193 | Eye Irritation: | 0.984 |
Respiratory Toxicity: | 0.017 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000016 | ![]() |
1.000 | D08QGD | ![]() |
0.286 | ||
ENC000874 | ![]() |
0.500 | D00ZOF | ![]() |
0.227 | ||
ENC000824 | ![]() |
0.391 | D02OAV | ![]() |
0.217 | ||
ENC004318 | ![]() |
0.333 | D00WUF | ![]() |
0.206 | ||
ENC000147 | ![]() |
0.333 | D0I8FI | ![]() |
0.205 | ||
ENC000057 | ![]() |
0.333 | D02UFG | ![]() |
0.205 | ||
ENC000814 | ![]() |
0.333 | D04EYC | ![]() |
0.184 | ||
ENC000037 | ![]() |
0.300 | D08HUC | ![]() |
0.184 | ||
ENC000149 | ![]() |
0.300 | D09PUL | ![]() |
0.182 | ||
ENC000010 | ![]() |
0.300 | D0Q9YT | ![]() |
0.180 |