![]() |
Name |
Bisabolol oxide B
|
Molecular Formula | C15H26O2 | |
IUPAC Name* |
2-[5-methyl-5-(4-methylcyclohex-3-en-1-yl)oxolan-2-yl]propan-2-ol
|
|
SMILES |
CC1=CCC(CC1)C2(CCC(O2)C(C)(C)O)C
|
|
InChI |
InChI=1S/C15H26O2/c1-11-5-7-12(8-6-11)15(4)10-9-13(17-15)14(2,3)16/h5,12-13,16H,6-10H2,1-4H3
|
|
InChIKey |
RKBAYVATPNYHLW-UHFFFAOYSA-N
|
|
Synonyms |
Bisabolol oxide B; 55399-12-7; alpha-Bisabolol oxide B; Tetrahydro-alpha,alpha,5-trimethyl-5-(4-methyl-3-cyclohexen-1-yl)furan-2-methanol; 2-[5-methyl-5-(4-methylcyclohex-3-en-1-yl)oxolan-2-yl]propan-2-ol; Bisabolol oxide II; .alpha.-Bisabolol oxide B; Bisabololoxide B; EINECS 259-624-9; (-)-alpha-Bisabolol oxide B; SCHEMBL10865738; CHEBI:80720; DTXSID30949059; 2-((2S,5S)-5-Methyl-5-((S)-4-methylcyclohex-3-en-1-yl)tetrahydrofuran-2-yl)propan-2-ol; 2-[5-Methyl-5-(4-methyl-3-cyclohexen-1-yl)tetrahydro-2-furanyl]-2-propanol #; 2-Furanmethanol, tetrahydro-.alpha.,.alpha.,5-trimethyl-5-(4-methyl-3-cyclohexen-1-yl)-; 2-Furanmethanol, tetrahydro-.alpha.,.alpha.,5-trimethyl-5-(4-methyl-3-cyclohexen-1-yl)-, [2S-[2.alpha.,5.beta.(R)]]-; Q27149762; 2-Furanmethanol, tetrahydro-alpha,alpha,5-trimethyl-5-(methyl-3-cyclohexen-1-yl)-; Tetrahydro-alpha,alpha,5-trimethyl-5-(4-methyl-3-cyclohexen-1-yl)-2-furanmethanol
|
|
CAS | 55399-12-7 | |
PubChem CID | 117301 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 238.37 | ALogp: | 2.5 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 29.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.731 |
Caco-2 Permeability: | -4.422 | MDCK Permeability: | 0.00001600 |
Pgp-inhibitor: | 0.022 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.181 |
30% Bioavailability (F30%): | 0.008 |
Blood-Brain-Barrier Penetration (BBB): | 0.415 | Plasma Protein Binding (PPB): | 93.97% |
Volume Distribution (VD): | 1.42 | Fu: | 5.06% |
CYP1A2-inhibitor: | 0.049 | CYP1A2-substrate: | 0.24 |
CYP2C19-inhibitor: | 0.055 | CYP2C19-substrate: | 0.897 |
CYP2C9-inhibitor: | 0.081 | CYP2C9-substrate: | 0.276 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.419 |
CYP3A4-inhibitor: | 0.039 | CYP3A4-substrate: | 0.213 |
Clearance (CL): | 11.73 | Half-life (T1/2): | 0.287 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.223 |
Drug-inuced Liver Injury (DILI): | 0.04 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.012 | Maximum Recommended Daily Dose: | 0.303 |
Skin Sensitization: | 0.554 | Carcinogencity: | 0.382 |
Eye Corrosion: | 0.033 | Eye Irritation: | 0.505 |
Respiratory Toxicity: | 0.122 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002289 | ![]() |
0.476 | D07QKN | ![]() |
0.322 | ||
ENC002827 | ![]() |
0.476 | D0K0EK | ![]() |
0.235 | ||
ENC003255 | ![]() |
0.475 | D0C7JF | ![]() |
0.227 | ||
ENC000511 | ![]() |
0.471 | D04GJN | ![]() |
0.226 | ||
ENC004619 | ![]() |
0.422 | D02VPX | ![]() |
0.223 | ||
ENC004620 | ![]() |
0.422 | D0B4RU | ![]() |
0.222 | ||
ENC004616 | ![]() |
0.422 | D0N1TP | ![]() |
0.219 | ||
ENC002420 | ![]() |
0.391 | D02ZGI | ![]() |
0.219 | ||
ENC004225 | ![]() |
0.388 | D05BTM | ![]() |
0.219 | ||
ENC004617 | ![]() |
0.379 | D0T2PL | ![]() |
0.219 |