![]() |
Name |
alpha-Pinene oxide
|
Molecular Formula | C10H16O | |
IUPAC Name* |
2,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane
|
|
SMILES |
CC1(C2CC1C3(C(C2)O3)C)C
|
|
InChI |
InChI=1S/C10H16O/c1-9(2)6-4-7(9)10(3)8(5-6)11-10/h6-8H,4-5H2,1-3H3
|
|
InChIKey |
NQFUSWIGRKFAHK-UHFFFAOYSA-N
|
|
Synonyms |
alpha-Pinene oxide; 2,3-Epoxypinane; 1686-14-2; alpha-Pinene epoxide; 2-Pinene oxide; Pinane, 2,3-epoxy-; Pinene oxide; alpha-Pineneoxide; .alpha.-Pinene oxide; .alpha.-Pinene epoxide; 2,7,7-Trimethyl-3-oxatricyclo[4.1.1.02,4]octane; Pinane, 2,3-epoxy-, (-)-; 2,3-Epoxy-pinane; 3-Oxatricyclo[4.1.1.02,4]octane, 2,7,7-trimethyl-; alpha-Pinene 2,3-oxide; CHEBI:29060; Pinane,3-epoxy-; NSC12148; 3-Oxatricyclo[4.1.1.0(2,4)]octane, 2,7,7-trimethyl-; Pinane,3-epoxy-, (-)-; 2,7,7-Trimethyl-3-oxatricyclo(4.1.1.02,4)octane; 2,7,7-trimethyl-3-oxatricyclo[4.1.1.0(2,4)]octane; 3-Oxatricyclo(4.1.1.02,4)octane, 2,7,7-trimethyl-; CCRIS 3762; 3-Oxatricyclo[4.1.1.02, 2,7,7-trimethyl-; NSC 5609; EINECS 216-869-6; NSC 12148; BRN 0080362; 1,2-Epoxypinane; Alpha-pinane oxide; I+/--Pinene oxide; 2,7,7-Trimethyl-3-oxatricyclo(4.1.1.0(sup 2,4))octane; 3-Oxatricyclo(4.1.1.0(sup 2,4))octane, 2,7,7-trimethyl-; bmse000491; .alpha.-Pinene 2,3-oxide; SCHEMBL93429; 5-17-01-00426 (Beilstein Handbook Reference); 218308_ALDRICH; CHEMBL274511; DTXSID5051781; NSC5609; NSC-5609; MFCD09025587; NSC-12148; NSC407160; AKOS015916312; NSC-407160; AS-68305; CS-0188178; FT-0691487; P1362; D97335; W-109695; 2,7,7-trimethyl-3-oxatricyclo[4.1.1.0?,?]octane; Q27104051; 2,7,7-Trimethyl-3-oxatricyclo[4.1.1.0~2,4~]octane; {3-Oxatricyclo[4.1.1.02,4]octane,} 2,7,7-trimethyl-; 2,7,7-TRIMETHYL-3-OXATRICYCLO[4.1.1.0(2),?]OCTANE
|
|
CAS | 1686-14-2 | |
PubChem CID | 91508 | |
ChEMBL ID | CHEMBL274511 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 152.23 | ALogp: | 2.1 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 12.5 | Aromatic Rings: | 4 |
Heavy Atoms: | 11 | QED Weighted: | 0.486 |
Caco-2 Permeability: | -4.543 | MDCK Permeability: | 0.00003130 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.101 |
Blood-Brain-Barrier Penetration (BBB): | 0.896 | Plasma Protein Binding (PPB): | 54.71% |
Volume Distribution (VD): | 1.939 | Fu: | 53.01% |
CYP1A2-inhibitor: | 0.109 | CYP1A2-substrate: | 0.363 |
CYP2C19-inhibitor: | 0.053 | CYP2C19-substrate: | 0.896 |
CYP2C9-inhibitor: | 0.21 | CYP2C9-substrate: | 0.213 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.699 |
CYP3A4-inhibitor: | 0.019 | CYP3A4-substrate: | 0.296 |
Clearance (CL): | 19.038 | Half-life (T1/2): | 0.18 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.216 |
Drug-inuced Liver Injury (DILI): | 0.025 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.047 | Maximum Recommended Daily Dose: | 0.86 |
Skin Sensitization: | 0.102 | Carcinogencity: | 0.054 |
Eye Corrosion: | 0.771 | Eye Irritation: | 0.976 |
Respiratory Toxicity: | 0.965 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001814 | ![]() |
0.439 | D0V8HA | ![]() |
0.292 | ||
ENC001192 | ![]() |
0.396 | D0H1QY | ![]() |
0.255 | ||
ENC002084 | ![]() |
0.341 | D0U3GL | ![]() |
0.197 | ||
ENC004898 | ![]() |
0.311 | D0Y2YP | ![]() |
0.188 | ||
ENC000153 | ![]() |
0.295 | D07VDZ | ![]() |
0.187 | ||
ENC005460 | ![]() |
0.281 | D02QJH | ![]() |
0.184 | ||
ENC005519 | ![]() |
0.277 | D04CSZ | ![]() |
0.180 | ||
ENC000085 | ![]() |
0.277 | D02JNM | ![]() |
0.179 | ||
ENC002228 | ![]() |
0.277 | D0N6FH | ![]() |
0.178 | ||
ENC001469 | ![]() |
0.276 | D0S3WH | ![]() |
0.178 |