|
Name |
Eicosane, 9-cyclohexyl-
|
Molecular Formula | C26H52 | |
IUPAC Name* |
icosan-9-ylcyclohexane
|
|
SMILES |
CCCCCCCCCCCC(CCCCCCCC)C1CCCCC1
|
|
InChI |
InChI=1S/C26H52/c1-3-5-7-9-11-12-13-15-18-22-25(26-23-19-16-20-24-26)21-17-14-10-8-6-4-2/h25-26H,3-24H2,1-2H3
|
|
InChIKey |
HFHMPSMIEOIWQO-UHFFFAOYSA-N
|
|
Synonyms |
Eicosane, 9-cyclohexyl-; 9-CYCLOHEXYLEICOSANE; 4443-61-2; icosan-9-ylcyclohexane; 9-CYCLOHEXYLICOSANE; NSC219881; (1-Octyldodecyl)cyclohexane #; Cyclohexane, (1-octyldodecyl)-; NSC 219881; NSC-219881
|
|
CAS | 4443-61-2 | |
PubChem CID | 20512 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 364.7 | ALogp: | 13.5 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 18 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 26 | QED Weighted: | 0.178 |
Caco-2 Permeability: | -5.037 | MDCK Permeability: | 0.00000529 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.076 |
30% Bioavailability (F30%): | 0.998 |
Blood-Brain-Barrier Penetration (BBB): | 0.005 | Plasma Protein Binding (PPB): | 99.03% |
Volume Distribution (VD): | 4.511 | Fu: | 0.70% |
CYP1A2-inhibitor: | 0.044 | CYP1A2-substrate: | 0.157 |
CYP2C19-inhibitor: | 0.127 | CYP2C19-substrate: | 0.06 |
CYP2C9-inhibitor: | 0.041 | CYP2C9-substrate: | 0.939 |
CYP2D6-inhibitor: | 0.051 | CYP2D6-substrate: | 0.03 |
CYP3A4-inhibitor: | 0.205 | CYP3A4-substrate: | 0.047 |
Clearance (CL): | 4.726 | Half-life (T1/2): | 0.008 |
hERG Blockers: | 0.455 | Human Hepatotoxicity (H-HT): | 0.018 |
Drug-inuced Liver Injury (DILI): | 0.695 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.014 | Maximum Recommended Daily Dose: | 0.041 |
Skin Sensitization: | 0.971 | Carcinogencity: | 0.016 |
Eye Corrosion: | 0.996 | Eye Irritation: | 0.928 |
Respiratory Toxicity: | 0.122 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001039 | 0.747 | D07ILQ | 0.447 | ||||
ENC000626 | 0.659 | D00AOJ | 0.444 | ||||
ENC000427 | 0.603 | D00FGR | 0.425 | ||||
ENC000400 | 0.600 | D0Z5SM | 0.413 | ||||
ENC000428 | 0.598 | D0T9TJ | 0.392 | ||||
ENC001180 | 0.593 | D0O1PH | 0.352 | ||||
ENC000379 | 0.584 | D05ATI | 0.352 | ||||
ENC000285 | 0.576 | D00MLW | 0.333 | ||||
ENC001143 | 0.566 | D0P1RL | 0.313 | ||||
ENC000423 | 0.566 | D00STJ | 0.310 |