|
Name |
Pulchranin A
|
Molecular Formula | C14H29N3O | |
IUPAC Name* |
1-(6-hydroxytridec-3-enyl)guanidine
|
|
SMILES |
CCCCCCCC(O)CC=CCCNC(=N)N
|
|
InChI |
InChI=1S/C14H29N3O/c1-2-3-4-5-7-10-13(18)11-8-6-9-12-17-14(15)16/h6,8,13,18H,2-5,7,9-12H2,1H3,(H4,15,16,17)/b8-6+
|
|
InChIKey |
OCUYXGUKXVZTSO-SOFGYWHQSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 255.41 | ALogp: | 2.5 |
HBD: | 4 | HBA: | 2 |
Rotatable Bonds: | 11 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 82.1 | Aromatic Rings: | 0 |
Heavy Atoms: | 18 | QED Weighted: | 0.198 |
Caco-2 Permeability: | -4.911 | MDCK Permeability: | 0.00016812 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.995 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.06 |
Blood-Brain-Barrier Penetration (BBB): | 0.2 | Plasma Protein Binding (PPB): | 73.24% |
Volume Distribution (VD): | 0.932 | Fu: | 45.70% |
CYP1A2-inhibitor: | 0.108 | CYP1A2-substrate: | 0.347 |
CYP2C19-inhibitor: | 0.014 | CYP2C19-substrate: | 0.053 |
CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.019 |
CYP2D6-inhibitor: | 0.896 | CYP2D6-substrate: | 0.72 |
CYP3A4-inhibitor: | 0.016 | CYP3A4-substrate: | 0.07 |
Clearance (CL): | 10.009 | Half-life (T1/2): | 0.156 |
hERG Blockers: | 0.329 | Human Hepatotoxicity (H-HT): | 0.054 |
Drug-inuced Liver Injury (DILI): | 0.007 | AMES Toxicity: | 0.009 |
Rat Oral Acute Toxicity: | 0.084 | Maximum Recommended Daily Dose: | 0.537 |
Skin Sensitization: | 0.874 | Carcinogencity: | 0.061 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.019 |
Respiratory Toxicity: | 0.892 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002562 | 0.442 | D0O1PH | 0.333 | ||||
ENC001655 | 0.426 | D0O1TC | 0.329 | ||||
ENC001677 | 0.426 | D0UE9X | 0.321 | ||||
ENC001612 | 0.424 | D06FEA | 0.308 | ||||
ENC001695 | 0.406 | D0I4DQ | 0.308 | ||||
ENC002845 | 0.403 | D07ILQ | 0.294 | ||||
ENC000420 | 0.400 | D09SRR | 0.289 | ||||
ENC001554 | 0.397 | D0OR6A | 0.284 | ||||
ENC004479 | 0.397 | D0H2YX | 0.279 | ||||
ENC001588 | 0.391 | D04RGA | 0.275 |