|
Name |
Alteamide
|
Molecular Formula | C11H19NO4 | |
IUPAC Name* |
methyl4-[(5-hydroxy-3-methylpent-2-enoyl)amino]butanoate
|
|
SMILES |
COC(=O)CCCNC(=O)C=C(C)CCO
|
|
InChI |
InChI=1S/C11H19NO4/c1-9(5-7-13)8-10(14)12-6-3-4-11(15)16-2/h8,13H,3-7H2,1-2H3,(H,12,14)/b9-8-
|
|
InChIKey |
DWLVPPJRMQEFNJ-HJWRWDBZSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 229.28 | ALogp: | 0.4 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 75.6 | Aromatic Rings: | 0 |
Heavy Atoms: | 16 | QED Weighted: | 0.384 |
Caco-2 Permeability: | -4.493 | MDCK Permeability: | 0.00008850 |
Pgp-inhibitor: | 0.017 | Pgp-substrate: | 0.212 |
Human Intestinal Absorption (HIA): | 0.091 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.126 |
Blood-Brain-Barrier Penetration (BBB): | 0.801 | Plasma Protein Binding (PPB): | 11.75% |
Volume Distribution (VD): | 0.696 | Fu: | 87.51% |
CYP1A2-inhibitor: | 0.045 | CYP1A2-substrate: | 0.251 |
CYP2C19-inhibitor: | 0.07 | CYP2C19-substrate: | 0.555 |
CYP2C9-inhibitor: | 0.02 | CYP2C9-substrate: | 0.447 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.285 |
CYP3A4-inhibitor: | 0.015 | CYP3A4-substrate: | 0.195 |
Clearance (CL): | 5.05 | Half-life (T1/2): | 0.957 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.14 |
Drug-inuced Liver Injury (DILI): | 0.065 | AMES Toxicity: | 0.013 |
Rat Oral Acute Toxicity: | 0.003 | Maximum Recommended Daily Dose: | 0.16 |
Skin Sensitization: | 0.864 | Carcinogencity: | 0.035 |
Eye Corrosion: | 0.021 | Eye Irritation: | 0.464 |
Respiratory Toxicity: | 0.025 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001036 | 0.469 | D0OL6O | 0.353 | ||||
ENC000516 | 0.421 | D0GC2M | 0.268 | ||||
ENC004359 | 0.418 | D07SJT | 0.266 | ||||
ENC005107 | 0.375 | D0ZI4H | 0.258 | ||||
ENC000735 | 0.375 | D0AY9Q | 0.250 | ||||
ENC004483 | 0.369 | D0E4WR | 0.238 | ||||
ENC000235 | 0.367 | D09ANG | 0.232 | ||||
ENC001253 | 0.358 | D01OXI | 0.227 | ||||
ENC000758 | 0.358 | D0Y7ZD | 0.222 | ||||
ENC001696 | 0.357 | D0EP8X | 0.220 |