|
Name |
Tricycloalternarene H
|
Molecular Formula | C21H28O5 | |
IUPAC Name* |
6-(7-hydroxy-3a-methyl-8-oxo-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-1-yl)-2-methylhept-2-enoicacid
|
|
SMILES |
CC(=CCCC(C)C1=CCC2(C)OC3=C(CC12)C(=O)C(O)CC3)C(=O)O
|
|
InChI |
InChI=1S/C21H28O5/c1-12(5-4-6-13(2)20(24)25)14-9-10-21(3)16(14)11-15-18(26-21)8-7-17(22)19(15)23/h6,9,12,16-17,22H,4-5,7-8,10-11H2,1-3H3,(H,24,25)/b13-6-/t12?,16-,17+,21+/m0/s1
|
|
InChIKey |
YHNVJMCINAHYRP-AXGOTUIISA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 360.45 | ALogp: | 3.5 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 83.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 26 | QED Weighted: | 0.565 |
Caco-2 Permeability: | -5.024 | MDCK Permeability: | 0.00001990 |
Pgp-inhibitor: | 0.037 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.02 | 20% Bioavailability (F20%): | 0.019 |
30% Bioavailability (F30%): | 0.011 |
Blood-Brain-Barrier Penetration (BBB): | 0.059 | Plasma Protein Binding (PPB): | 98.88% |
Volume Distribution (VD): | 0.255 | Fu: | 1.83% |
CYP1A2-inhibitor: | 0.133 | CYP1A2-substrate: | 0.896 |
CYP2C19-inhibitor: | 0.032 | CYP2C19-substrate: | 0.177 |
CYP2C9-inhibitor: | 0.355 | CYP2C9-substrate: | 0.234 |
CYP2D6-inhibitor: | 0.29 | CYP2D6-substrate: | 0.221 |
CYP3A4-inhibitor: | 0.031 | CYP3A4-substrate: | 0.142 |
Clearance (CL): | 9.852 | Half-life (T1/2): | 0.821 |
hERG Blockers: | 0.04 | Human Hepatotoxicity (H-HT): | 0.702 |
Drug-inuced Liver Injury (DILI): | 0.046 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.035 | Maximum Recommended Daily Dose: | 0.217 |
Skin Sensitization: | 0.929 | Carcinogencity: | 0.354 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.019 |
Respiratory Toxicity: | 0.695 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004443 | 0.795 | D04ATM | 0.239 | ||||
ENC001868 | 0.795 | D02CNR | 0.233 | ||||
ENC005805 | 0.795 | D0S8LV | 0.231 | ||||
ENC003212 | 0.647 | D01CKY | 0.228 | ||||
ENC003577 | 0.644 | D0T2PL | 0.224 | ||||
ENC003124 | 0.640 | D08SVH | 0.224 | ||||
ENC001869 | 0.628 | D0F2AK | 0.221 | ||||
ENC005807 | 0.628 | D04VIS | 0.219 | ||||
ENC003211 | 0.505 | D02VPX | 0.218 | ||||
ENC003123 | 0.500 | D02ZGI | 0.214 |