|
Name |
7-hydroxy-1-[(E)-7-hydroxy-6-methylhept-5-en-2-yl]-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one
|
Molecular Formula | C21H30O4 | |
IUPAC Name* |
7-hydroxy-1-[(E)-7-hydroxy-6-methylhept-5-en-2-yl]-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one
|
|
SMILES |
CC(CC/C=C(\C)/CO)C1=CCC2(C1CC3=C(O2)CCC(C3=O)O)C
|
|
InChI |
InChI=1S/C21H30O4/c1-13(12-22)5-4-6-14(2)15-9-10-21(3)17(15)11-16-19(25-21)8-7-18(23)20(16)24/h5,9,14,17-18,22-23H,4,6-8,10-12H2,1-3H3/b13-5+
|
|
InChIKey |
KOATXBNOVXBDJE-WLRTZDKTSA-N
|
|
Synonyms |
Tricycloalternarene 2b; 103873-59-2; 7-hydroxy-1-[(E)-7-hydroxy-6-methylhept-5-en-2-yl]-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one; ACTG Toxin D; CHEBI:181300; NCGC00380084-01; Cyclopenta(b)(1)benzopyran-8(3H)-one, 3a,5,6,7,9,9a-hexahydro-7-hydroxy-1-(6-hydroxy-1,5-dimethyl-4-hexenyl)-3a-methyl-; NCGC00380084-01_C21H30O4_Benzo[b]cyclopenta[e]pyran-8(3H)-one, 3a,5,6,7,9,9a-hexahydro-7-hydroxy-1-[(4E)-6-hydroxy-1,5-dimethyl-4-hexen-1-yl]-3a-methyl-
|
|
CAS | 103873-59-2 | |
PubChem CID | 6443493 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 346.5 | ALogp: | 2.7 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 25 | QED Weighted: | 0.733 |
Caco-2 Permeability: | -4.643 | MDCK Permeability: | 0.00001980 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.012 |
Human Intestinal Absorption (HIA): | 0.015 | 20% Bioavailability (F20%): | 0.285 |
30% Bioavailability (F30%): | 0.037 |
Blood-Brain-Barrier Penetration (BBB): | 0.153 | Plasma Protein Binding (PPB): | 99.08% |
Volume Distribution (VD): | 1.745 | Fu: | 1.16% |
CYP1A2-inhibitor: | 0.367 | CYP1A2-substrate: | 0.657 |
CYP2C19-inhibitor: | 0.163 | CYP2C19-substrate: | 0.532 |
CYP2C9-inhibitor: | 0.253 | CYP2C9-substrate: | 0.568 |
CYP2D6-inhibitor: | 0.543 | CYP2D6-substrate: | 0.859 |
CYP3A4-inhibitor: | 0.157 | CYP3A4-substrate: | 0.298 |
Clearance (CL): | 14.074 | Half-life (T1/2): | 0.772 |
hERG Blockers: | 0.031 | Human Hepatotoxicity (H-HT): | 0.524 |
Drug-inuced Liver Injury (DILI): | 0.031 | AMES Toxicity: | 0.013 |
Rat Oral Acute Toxicity: | 0.094 | Maximum Recommended Daily Dose: | 0.107 |
Skin Sensitization: | 0.916 | Carcinogencity: | 0.095 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.029 |
Respiratory Toxicity: | 0.891 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005805 | 1.000 | D0T2PL | 0.238 | ||||
ENC005806 | 0.795 | D04VIS | 0.234 | ||||
ENC001869 | 0.792 | D02VPX | 0.231 | ||||
ENC003212 | 0.704 | D08SVH | 0.228 | ||||
ENC003124 | 0.655 | D0K5WS | 0.225 | ||||
ENC003577 | 0.640 | D0L7AS | 0.222 | ||||
ENC005807 | 0.624 | D04ATM | 0.221 | ||||
ENC003211 | 0.551 | D0Y7IU | 0.220 | ||||
ENC003123 | 0.511 | D04QNO | 0.220 | ||||
ENC003122 | 0.421 | D02ZGI | 0.218 |