|
Name |
Tricycloalternarene G
|
Molecular Formula | C21H30O4 | |
IUPAC Name* |
7-hydroxy-1-(7-hydroxy-6-methylhept-5-en-2-yl)-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one
|
|
SMILES |
CC(=CCCC(C)C1=CCC2(C)OC3=C(CC12)C(=O)C(O)CC3)CO
|
|
InChI |
InChI=1S/C21H30O4/c1-13(12-22)5-4-6-14(2)15-9-10-21(3)17(15)11-16-19(25-21)8-7-18(23)20(16)24/h5,9,14,17-18,22-23H,4,6-8,10-12H2,1-3H3/b13-5-/t14?,17-,18+,21+/m0/s1
|
|
InChIKey |
KOATXBNOVXBDJE-JDEPSGNSSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 346.47 | ALogp: | 3.4 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 3 |
Heavy Atoms: | 25 | QED Weighted: | 0.733 |
Caco-2 Permeability: | -4.597 | MDCK Permeability: | 0.00001640 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.817 |
30% Bioavailability (F30%): | 0.378 |
Blood-Brain-Barrier Penetration (BBB): | 0.194 | Plasma Protein Binding (PPB): | 99.09% |
Volume Distribution (VD): | 6.589 | Fu: | 2.20% |
CYP1A2-inhibitor: | 0.419 | CYP1A2-substrate: | 0.536 |
CYP2C19-inhibitor: | 0.139 | CYP2C19-substrate: | 0.478 |
CYP2C9-inhibitor: | 0.284 | CYP2C9-substrate: | 0.468 |
CYP2D6-inhibitor: | 0.419 | CYP2D6-substrate: | 0.713 |
CYP3A4-inhibitor: | 0.172 | CYP3A4-substrate: | 0.29 |
Clearance (CL): | 18.16 | Half-life (T1/2): | 0.67 |
hERG Blockers: | 0.034 | Human Hepatotoxicity (H-HT): | 0.641 |
Drug-inuced Liver Injury (DILI): | 0.039 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.094 | Maximum Recommended Daily Dose: | 0.075 |
Skin Sensitization: | 0.9 | Carcinogencity: | 0.591 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.03 |
Respiratory Toxicity: | 0.888 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001868 | 1.000 | D0T2PL | 0.238 | ||||
ENC005806 | 0.795 | D04VIS | 0.234 | ||||
ENC004443 | 0.792 | D02VPX | 0.231 | ||||
ENC001869 | 0.792 | D08SVH | 0.228 | ||||
ENC003212 | 0.704 | D0K5WS | 0.225 | ||||
ENC003124 | 0.655 | D0L7AS | 0.222 | ||||
ENC003577 | 0.640 | D04ATM | 0.221 | ||||
ENC005807 | 0.624 | D0Y7IU | 0.220 | ||||
ENC003211 | 0.551 | D04QNO | 0.220 | ||||
ENC003123 | 0.511 | D02ZGI | 0.218 |