|
Name |
Penicibisabolane G
|
Molecular Formula | C15H20O4 | |
IUPAC Name* |
3-hydroxy-4-(6-hydroxy-6-methylhept-1-en-2-yl)benzoicacid
|
|
SMILES |
C=C(CCCC(C)(C)O)c1ccc(C(=O)O)cc1O
|
|
InChI |
InChI=1S/C15H20O4/c1-10(5-4-8-15(2,3)19)12-7-6-11(14(17)18)9-13(12)16/h6-7,9,16,19H,1,4-5,8H2,2-3H3,(H,17,18)
|
|
InChIKey |
OTGUTWCLOUSGAA-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 264.32 | ALogp: | 3.0 |
HBD: | 3 | HBA: | 3 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 77.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 19 | QED Weighted: | 0.729 |
Caco-2 Permeability: | -4.758 | MDCK Permeability: | 0.00001860 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.114 | Plasma Protein Binding (PPB): | 75.40% |
Volume Distribution (VD): | 0.517 | Fu: | 30.45% |
CYP1A2-inhibitor: | 0.216 | CYP1A2-substrate: | 0.164 |
CYP2C19-inhibitor: | 0.067 | CYP2C19-substrate: | 0.048 |
CYP2C9-inhibitor: | 0.55 | CYP2C9-substrate: | 0.167 |
CYP2D6-inhibitor: | 0.212 | CYP2D6-substrate: | 0.094 |
CYP3A4-inhibitor: | 0.05 | CYP3A4-substrate: | 0.076 |
Clearance (CL): | 3.117 | Half-life (T1/2): | 0.901 |
hERG Blockers: | 0.03 | Human Hepatotoxicity (H-HT): | 0.512 |
Drug-inuced Liver Injury (DILI): | 0.966 | AMES Toxicity: | 0.014 |
Rat Oral Acute Toxicity: | 0.053 | Maximum Recommended Daily Dose: | 0.022 |
Skin Sensitization: | 0.184 | Carcinogencity: | 0.114 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.324 |
Respiratory Toxicity: | 0.038 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004194 | 0.656 | D01WJL | 0.362 | ||||
ENC002688 | 0.639 | D0BA6T | 0.328 | ||||
ENC003717 | 0.639 | D05VIX | 0.324 | ||||
ENC002565 | 0.594 | D0C4YC | 0.317 | ||||
ENC002383 | 0.594 | D0P7JZ | 0.314 | ||||
ENC002564 | 0.515 | D0Y6KO | 0.297 | ||||
ENC005624 | 0.493 | D0S2BT | 0.290 | ||||
ENC004442 | 0.493 | D02ZJI | 0.284 | ||||
ENC005621 | 0.493 | D0K5CB | 0.284 | ||||
ENC005626 | 0.486 | D07HBX | 0.283 |