|
Name |
(5S,6S)-6-((3’S,4’S,Z)-3’,4’-Dihydroxypent-1-en-1-yl)-5-hydroxy-5,6-dihydro-2H-pyran-2-one
|
Molecular Formula | C10H14O5 | |
IUPAC Name* |
2-(3,4-dihydroxypent-1-enyl)-3-hydroxy-2,3-dihydropyran-6-one
|
|
SMILES |
CC(O)C(O)C=CC1OC(=O)C=CC1O
|
|
InChI |
InChI=1S/C10H14O5/c1-6(11)7(12)2-4-9-8(13)3-5-10(14)15-9/h2-9,11-13H,1H3/b4-2-/t6-,7-,8-,9-/m0/s1
|
|
InChIKey |
QSADHPFXDNSPKB-HNOOBCQNSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 214.22 | ALogp: | -0.9 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.44 |
Caco-2 Permeability: | -4.878 | MDCK Permeability: | 0.00021411 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.75 |
Human Intestinal Absorption (HIA): | 0.508 | 20% Bioavailability (F20%): | 0.147 |
30% Bioavailability (F30%): | 0.981 |
Blood-Brain-Barrier Penetration (BBB): | 0.223 | Plasma Protein Binding (PPB): | 63.22% |
Volume Distribution (VD): | 0.694 | Fu: | 47.82% |
CYP1A2-inhibitor: | 0.04 | CYP1A2-substrate: | 0.816 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.08 |
CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.863 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.594 |
CYP3A4-inhibitor: | 0.007 | CYP3A4-substrate: | 0.106 |
Clearance (CL): | 12.003 | Half-life (T1/2): | 0.852 |
hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.596 |
Drug-inuced Liver Injury (DILI): | 0.815 | AMES Toxicity: | 0.042 |
Rat Oral Acute Toxicity: | 0.027 | Maximum Recommended Daily Dose: | 0.019 |
Skin Sensitization: | 0.095 | Carcinogencity: | 0.359 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.08 |
Respiratory Toxicity: | 0.064 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001883 | 0.591 | D05ZTH | 0.204 | ||||
ENC005124 | 0.591 | D0N3NO | 0.188 | ||||
ENC001863 | 0.548 | D07AHW | 0.183 | ||||
ENC003396 | 0.520 | D0V0IX | 0.183 | ||||
ENC003191 | 0.412 | D0Q9YT | 0.178 | ||||
ENC005753 | 0.368 | D00NPP | 0.176 | ||||
ENC004213 | 0.352 | D02RQU | 0.175 | ||||
ENC002163 | 0.333 | D0S2IQ | 0.173 | ||||
ENC001864 | 0.333 | D0I4DQ | 0.172 | ||||
ENC005532 | 0.333 | D06FEA | 0.172 |