|
Name |
phomopsolide A
|
Molecular Formula | C15H18O6 | |
IUPAC Name* |
[(2S,3S)-2-[(Z)-4-hydroxy-3-oxopent-1-enyl]-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate
|
|
SMILES |
C/C=C(\C)/C(=O)O[C@H]1C=CC(=O)O[C@H]1/C=C\C(=O)C(C)O
|
|
InChI |
InChI=1S/C15H18O6/c1-4-9(2)15(19)21-13-7-8-14(18)20-12(13)6-5-11(17)10(3)16/h4-8,10,12-13,16H,1-3H3/b6-5-,9-4+/t10?,12-,13-/m0/s1
|
|
InChIKey |
LJWPJGJLPBFTPH-UZXIAGNXSA-N
|
|
Synonyms |
phomopsolide A; 97529-83-4; [(2S,3S)-2-[(Z)-4-hydroxy-3-oxopent-1-enyl]-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate; CHEMBL508075
|
|
CAS | 97529-83-4 | |
PubChem CID | 6442340 | |
ChEMBL ID | CHEMBL508075 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 294.3 | ALogp: | 1.1 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 89.9 | Aromatic Rings: | 1 |
Heavy Atoms: | 21 | QED Weighted: | 0.606 |
Caco-2 Permeability: | -4.671 | MDCK Permeability: | 0.00002140 |
Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.017 | 20% Bioavailability (F20%): | 0.006 |
30% Bioavailability (F30%): | 0.165 |
Blood-Brain-Barrier Penetration (BBB): | 0.385 | Plasma Protein Binding (PPB): | 85.27% |
Volume Distribution (VD): | 0.306 | Fu: | 20.27% |
CYP1A2-inhibitor: | 0.43 | CYP1A2-substrate: | 0.751 |
CYP2C19-inhibitor: | 0.435 | CYP2C19-substrate: | 0.089 |
CYP2C9-inhibitor: | 0.351 | CYP2C9-substrate: | 0.713 |
CYP2D6-inhibitor: | 0.127 | CYP2D6-substrate: | 0.434 |
CYP3A4-inhibitor: | 0.036 | CYP3A4-substrate: | 0.249 |
Clearance (CL): | 7.065 | Half-life (T1/2): | 0.919 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.346 |
Drug-inuced Liver Injury (DILI): | 0.575 | AMES Toxicity: | 0.122 |
Rat Oral Acute Toxicity: | 0.071 | Maximum Recommended Daily Dose: | 0.156 |
Skin Sensitization: | 0.415 | Carcinogencity: | 0.53 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.072 |
Respiratory Toxicity: | 0.107 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001863 | 0.697 | D0E9KA | 0.232 | ||||
ENC005693 | 0.606 | D0OL7F | 0.200 | ||||
ENC005692 | 0.581 | D0ZI4H | 0.195 | ||||
ENC003191 | 0.455 | D06WTZ | 0.193 | ||||
ENC002128 | 0.346 | D02RQU | 0.191 | ||||
ENC005124 | 0.344 | D0T6WT | 0.189 | ||||
ENC001883 | 0.344 | D09SIK | 0.189 | ||||
ENC003396 | 0.333 | D00NPP | 0.184 | ||||
ENC003321 | 0.333 | D09WYX | 0.180 | ||||
ENC003192 | 0.333 | D0WV4M | 0.176 |