|
Name |
koninginin N
|
Molecular Formula | C16H24O4 | |
IUPAC Name* |
7-hydroxy-2-(2-oxooctyl)-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one
|
|
SMILES |
CCCCCCC(=O)CC1CC2=C(O1)C(O)CCC2=O
|
|
InChI |
InChI=1S/C16H24O4/c1-2-3-4-5-6-11(17)9-12-10-13-14(18)7-8-15(19)16(13)20-12/h12,15,19H,2-10H2,1H3/t12-,15-/m1/s1
|
|
InChIKey |
HIOHXXFEWZUKDP-IUODEOHRSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 280.36 | ALogp: | 2.7 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 63.6 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.725 |
Caco-2 Permeability: | -4.626 | MDCK Permeability: | 0.00002590 |
Pgp-inhibitor: | 0.949 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.015 | 20% Bioavailability (F20%): | 0.347 |
30% Bioavailability (F30%): | 0.129 |
Blood-Brain-Barrier Penetration (BBB): | 0.506 | Plasma Protein Binding (PPB): | 56.90% |
Volume Distribution (VD): | 0.931 | Fu: | 37.30% |
CYP1A2-inhibitor: | 0.022 | CYP1A2-substrate: | 0.475 |
CYP2C19-inhibitor: | 0.046 | CYP2C19-substrate: | 0.581 |
CYP2C9-inhibitor: | 0.056 | CYP2C9-substrate: | 0.669 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.603 |
CYP3A4-inhibitor: | 0.045 | CYP3A4-substrate: | 0.161 |
Clearance (CL): | 13.222 | Half-life (T1/2): | 0.92 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.265 |
Drug-inuced Liver Injury (DILI): | 0.389 | AMES Toxicity: | 0.084 |
Rat Oral Acute Toxicity: | 0.927 | Maximum Recommended Daily Dose: | 0.259 |
Skin Sensitization: | 0.047 | Carcinogencity: | 0.509 |
Eye Corrosion: | 0.009 | Eye Irritation: | 0.136 |
Respiratory Toxicity: | 0.034 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003976 | 0.597 | D03ZJE | 0.353 | ||||
ENC002643 | 0.534 | D00CTS | 0.313 | ||||
ENC002146 | 0.534 | D0XN8C | 0.307 | ||||
ENC005927 | 0.534 | D0I4DQ | 0.302 | ||||
ENC003975 | 0.470 | D0ZI4H | 0.298 | ||||
ENC002090 | 0.462 | D0L7AS | 0.287 | ||||
ENC002691 | 0.444 | D0V0IX | 0.286 | ||||
ENC005893 | 0.429 | D06FEA | 0.276 | ||||
ENC005887 | 0.390 | D09ANG | 0.275 | ||||
ENC005890 | 0.390 | D0AY9Q | 0.273 |