NPs Basic Information
|
Name |
14-ketokoninginin B
|
| Molecular Formula | C16H24O5 | |
| IUPAC Name* |
6-hydroxy-2-(1-hydroxy-5-oxoheptyl)-2,3,4,6,7,8-hexahydrochromen-5-one
|
|
| SMILES |
CCC(=O)CCCC(O)C1CCC2=C(CCC(O)C2=O)O1
|
|
| InChI |
InChI=1S/C16H24O5/c1-2-10(17)4-3-5-12(18)15-8-6-11-14(21-15)9-7-13(19)16(11)20/h12-13,15,18-19H,2-9H2,1H3/t12-,13+,15-/m0/s1
|
|
| InChIKey |
MJWBGILXIAAZHO-GUTXKFCHSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 296.36 | ALogp: | 1.7 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 83.8 | Aromatic Rings: | 2 |
| Heavy Atoms: | 21 | QED Weighted: | 0.785 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.709 | MDCK Permeability: | 0.00003210 |
| Pgp-inhibitor: | 0.985 | Pgp-substrate: | 0.017 |
| Human Intestinal Absorption (HIA): | 0.513 | 20% Bioavailability (F20%): | 0.647 |
| 30% Bioavailability (F30%): | 0.249 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.863 | Plasma Protein Binding (PPB): | 57.33% |
| Volume Distribution (VD): | 0.394 | Fu: | 37.06% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.313 |
| CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.172 |
| CYP2C9-inhibitor: | 0.011 | CYP2C9-substrate: | 0.189 |
| CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.547 |
| CYP3A4-inhibitor: | 0.012 | CYP3A4-substrate: | 0.253 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 9.484 | Half-life (T1/2): | 0.818 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.224 |
| Drug-inuced Liver Injury (DILI): | 0.252 | AMES Toxicity: | 0.288 |
| Rat Oral Acute Toxicity: | 0.464 | Maximum Recommended Daily Dose: | 0.779 |
| Skin Sensitization: | 0.184 | Carcinogencity: | 0.07 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.042 |
| Respiratory Toxicity: | 0.142 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003574 |  |
0.785 | D0V0IX |  |
0.231 | ||
| ENC005891 |  |
0.706 | D0U0KW |  |
0.228 | ||
| ENC005466 |  |
0.681 | D0F2AK |  |
0.225 | ||
| ENC005893 |  |
0.584 | D0ZI4H |  |
0.223 | ||
| ENC005927 |  |
0.541 | D02IIW |  |
0.222 | ||
| ENC002146 |  |
0.541 | D0I4DQ |  |
0.221 | ||
| ENC002643 |  |
0.541 | D06FEA |  |
0.221 | ||
| ENC005887 |  |
0.526 | D04ATM |  |
0.221 | ||
| ENC003134 |  |
0.487 | D03ZJE |  |
0.219 | ||
| ENC005892 |  |
0.469 | D0Z1UA |  |
0.216 | ||