NPs Basic Information
|
Name |
14-hydroxykoninginin E
|
| Molecular Formula | C16H26O5 | |
| IUPAC Name* |
2-(1,5-dihydroxyheptyl)-8-hydroxy-2,3,4,6,7,8-hexahydrochromen-5-one
|
|
| SMILES |
CCC(O)CCCC(O)C1CCC2=C(O1)C(O)CCC2=O
|
|
| InChI |
InChI=1S/C16H26O5/c1-2-10(17)4-3-5-13(19)15-9-6-11-12(18)7-8-14(20)16(11)21-15/h10,13-15,17,19-20H,2-9H2,1H3/t10-,13+,14-,15+/m1/s1
|
|
| InChIKey |
RVSNFPBHKQUUFW-KAOXEZKKSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 298.38 | ALogp: | 1.4 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 87.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 21 | QED Weighted: | 0.698 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.772 | MDCK Permeability: | 0.00001740 |
| Pgp-inhibitor: | 0.234 | Pgp-substrate: | 0.658 |
| Human Intestinal Absorption (HIA): | 0.439 | 20% Bioavailability (F20%): | 0.881 |
| 30% Bioavailability (F30%): | 0.027 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.275 | Plasma Protein Binding (PPB): | 36.98% |
| Volume Distribution (VD): | 1.086 | Fu: | 51.09% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.01 | CYP1A2-substrate: | 0.399 |
| CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.387 |
| CYP2C9-inhibitor: | 0.008 | CYP2C9-substrate: | 0.313 |
| CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.485 |
| CYP3A4-inhibitor: | 0.006 | CYP3A4-substrate: | 0.115 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 14.892 | Half-life (T1/2): | 0.89 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.343 |
| Drug-inuced Liver Injury (DILI): | 0.136 | AMES Toxicity: | 0.036 |
| Rat Oral Acute Toxicity: | 0.962 | Maximum Recommended Daily Dose: | 0.883 |
| Skin Sensitization: | 0.048 | Carcinogencity: | 0.108 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.028 |
| Respiratory Toxicity: | 0.027 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005891 |  |
0.758 | D0Z1UA |  |
0.237 | ||
| ENC002643 |  |
0.727 | D01WUA |  |
0.234 | ||
| ENC002146 |  |
0.727 | D0K5WS |  |
0.225 | ||
| ENC005927 |  |
0.727 | D04VIS |  |
0.223 | ||
| ENC005466 |  |
0.589 | D02ZGI |  |
0.217 | ||
| ENC005890 |  |
0.526 | D08SVH |  |
0.217 | ||
| ENC003574 |  |
0.506 | D0V0IX |  |
0.208 | ||
| ENC002090 |  |
0.506 | D0T2PL |  |
0.207 | ||
| ENC002691 |  |
0.469 | D07AHW |  |
0.203 | ||
| ENC005465 |  |
0.443 | D02VPX |  |
0.200 | ||