|
Name |
(R)-piliformic acid
|
Molecular Formula | C18H14N2O6 | |
IUPAC Name* |
2-[[4-(2-carboxyanilino)-4-oxobut-2-enoyl]amino]benzoicacid
|
|
SMILES |
O=C(C=CC(=O)Nc1ccccc1C(=O)O)Nc1ccccc1C(=O)O
|
|
InChI |
InChI=1S/C18H14N2O6/c21-15(19-13-7-3-1-5-11(13)17(23)24)9-10-16(22)20-14-8-4-2-6-12(14)18(25)26/h1-10H,(H,19,21)(H,20,22)(H,23,24)(H,25,26)/b10-9+
|
|
InChIKey |
PZWAOAJYFINXQO-MDZDMXLPSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 354.32 | ALogp: | 2.2 |
HBD: | 4 | HBA: | 4 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 132.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 26 | QED Weighted: | 0.59 |
Caco-2 Permeability: | -6.198 | MDCK Permeability: | 0.00000488 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.892 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.392 |
Blood-Brain-Barrier Penetration (BBB): | 0.065 | Plasma Protein Binding (PPB): | 74.76% |
Volume Distribution (VD): | 0.209 | Fu: | 11.19% |
CYP1A2-inhibitor: | 0.127 | CYP1A2-substrate: | 0.021 |
CYP2C19-inhibitor: | 0.157 | CYP2C19-substrate: | 0.035 |
CYP2C9-inhibitor: | 0.551 | CYP2C9-substrate: | 0.093 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.088 |
CYP3A4-inhibitor: | 0.059 | CYP3A4-substrate: | 0.017 |
Clearance (CL): | 0.588 | Half-life (T1/2): | 0.95 |
hERG Blockers: | 0.167 | Human Hepatotoxicity (H-HT): | 0.234 |
Drug-inuced Liver Injury (DILI): | 0.99 | AMES Toxicity: | 0.026 |
Rat Oral Acute Toxicity: | 0.273 | Maximum Recommended Daily Dose: | 0.013 |
Skin Sensitization: | 0.818 | Carcinogencity: | 0.018 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.282 |
Respiratory Toxicity: | 0.933 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000055 | 0.405 | D0Y0JH | 0.453 | ||||
ENC000684 | 0.375 | D0E6OC | 0.448 | ||||
ENC003916 | 0.360 | D05FTJ | 0.402 | ||||
ENC001428 | 0.360 | D0B2WJ | 0.366 | ||||
ENC001805 | 0.355 | D08IFL | 0.333 | ||||
ENC004239 | 0.313 | D08GJO | 0.320 | ||||
ENC005251 | 0.306 | D02IHW | 0.316 | ||||
ENC002247 | 0.305 | D0L0SW | 0.308 | ||||
ENC003644 | 0.299 | D0ZJ1C | 0.303 | ||||
ENC001443 | 0.295 | D0W9WF | 0.302 |