|
Name |
(+)-nigrosporione D
|
Molecular Formula | C9H12O3 | |
IUPAC Name* |
(5S)-5-(hydroxymethyl)-3-methoxy-5-methyl-4-methylidenecyclopent-2-en-1-one
|
|
SMILES |
C[C@]1(C(=C)C(=CC1=O)OC)CO
|
|
InChI |
InChI=1S/C9H12O3/c1-6-7(12-3)4-8(11)9(6,2)5-10/h4,10H,1,5H2,2-3H3/t9-/m1/s1
|
|
InChIKey |
IVWZSQCKWUPCTA-SECBINFHSA-N
|
|
Synonyms |
(+)-nigrosporione D
|
|
CAS | NA | |
PubChem CID | 146684214 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 168.19 | ALogp: | 0.6 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.67 |
Caco-2 Permeability: | -4.485 | MDCK Permeability: | 0.00003110 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 0.861 |
30% Bioavailability (F30%): | 0.655 |
Blood-Brain-Barrier Penetration (BBB): | 0.911 | Plasma Protein Binding (PPB): | 39.50% |
Volume Distribution (VD): | 1.376 | Fu: | 68.30% |
CYP1A2-inhibitor: | 0.078 | CYP1A2-substrate: | 0.91 |
CYP2C19-inhibitor: | 0.046 | CYP2C19-substrate: | 0.839 |
CYP2C9-inhibitor: | 0.023 | CYP2C9-substrate: | 0.094 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.07 |
CYP3A4-inhibitor: | 0.022 | CYP3A4-substrate: | 0.408 |
Clearance (CL): | 5.436 | Half-life (T1/2): | 0.74 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.846 |
Drug-inuced Liver Injury (DILI): | 0.069 | AMES Toxicity: | 0.608 |
Rat Oral Acute Toxicity: | 0.457 | Maximum Recommended Daily Dose: | 0.114 |
Skin Sensitization: | 0.491 | Carcinogencity: | 0.905 |
Eye Corrosion: | 0.494 | Eye Irritation: | 0.492 |
Respiratory Toxicity: | 0.944 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004168 | 1.000 | D0H6VY | 0.196 | ||||
ENC004966 | 0.426 | D0E9CD | 0.196 | ||||
ENC004965 | 0.426 | D0Q4XQ | 0.188 | ||||
ENC005579 | 0.383 | D0N0OU | 0.188 | ||||
ENC004166 | 0.380 | D09JBP | 0.180 | ||||
ENC004165 | 0.380 | D04VIS | 0.179 | ||||
ENC005472 | 0.347 | D02XJY | 0.176 | ||||
ENC001525 | 0.347 | D0A2AJ | 0.174 | ||||
ENC005909 | 0.327 | D08CCE | 0.167 | ||||
ENC004712 | 0.327 | D0U4VT | 0.167 |