|
Name |
Coriloxine
|
Molecular Formula | C8H10O4 | |
IUPAC Name* |
5-hydroxy-4-methoxy-6-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one
|
|
SMILES |
COC1=CC(=O)C2OC2(C)C1O
|
|
InChI |
InChI=1S/C8H10O4/c1-8-6(10)5(11-2)3-4(9)7(8)12-8/h3,6-7,10H,1-2H3/t6-,7-,8+/m0/s1
|
|
InChIKey |
AIVUQNKTJDAYQX-BIIVOSGPSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 170.16 | ALogp: | -0.4 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 59.1 | Aromatic Rings: | 2 |
Heavy Atoms: | 12 | QED Weighted: | 0.565 |
Caco-2 Permeability: | -4.586 | MDCK Permeability: | 0.00001620 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.008 |
Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.01 |
Blood-Brain-Barrier Penetration (BBB): | 0.682 | Plasma Protein Binding (PPB): | 21.29% |
Volume Distribution (VD): | 1.066 | Fu: | 82.19% |
CYP1A2-inhibitor: | 0.011 | CYP1A2-substrate: | 0.926 |
CYP2C19-inhibitor: | 0.021 | CYP2C19-substrate: | 0.861 |
CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.078 |
CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.285 |
CYP3A4-inhibitor: | 0.007 | CYP3A4-substrate: | 0.481 |
Clearance (CL): | 10.836 | Half-life (T1/2): | 0.866 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.122 |
Drug-inuced Liver Injury (DILI): | 0.789 | AMES Toxicity: | 0.623 |
Rat Oral Acute Toxicity: | 0.908 | Maximum Recommended Daily Dose: | 0.026 |
Skin Sensitization: | 0.297 | Carcinogencity: | 0.798 |
Eye Corrosion: | 0.936 | Eye Irritation: | 0.669 |
Respiratory Toxicity: | 0.776 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
D03SKD | 0.198 | ||||||
D0U4VT | 0.188 | ||||||
D0X5KF | 0.188 | ||||||
D06XMU | 0.182 | ||||||
D0R9VR | 0.179 | ||||||
D09JBP | 0.176 | ||||||
D0L1WV | 0.174 | ||||||
D0K7LU | 0.174 | ||||||
D03DIG | 0.173 | ||||||
D0T6RC | 0.173 |