NPs Basic Information
|
Name |
Fusaricate H
|
| Molecular Formula | C14H21NO3 | |
| IUPAC Name* |
[(2R,3R)-3-hydroxybutan-2-yl] 5-butylpyridine-2-carboxylate
|
|
| SMILES |
CCCCC1=CN=C(C=C1)C(=O)O[C@H](C)[C@@H](C)O
|
|
| InChI |
InChI=1S/C14H21NO3/c1-4-5-6-12-7-8-13(15-9-12)14(17)18-11(3)10(2)16/h7-11,16H,4-6H2,1-3H3/t10-,11-/m1/s1
|
|
| InChIKey |
SUNALTYKQWMYGQ-GHMZBOCLSA-N
|
|
| Synonyms |
Fusaricate H
|
|
| CAS | NA | |
| PubChem CID | 146682367 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 251.32 | ALogp: | 3.1 |
| HBD: | 1 | HBA: | 4 |
| Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 59.4 | Aromatic Rings: | 1 |
| Heavy Atoms: | 18 | QED Weighted: | 0.789 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.384 | MDCK Permeability: | 0.00002420 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.006 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.009 |
| 30% Bioavailability (F30%): | 0.716 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.639 | Plasma Protein Binding (PPB): | 89.05% |
| Volume Distribution (VD): | 3.015 | Fu: | 5.41% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.84 | CYP1A2-substrate: | 0.875 |
| CYP2C19-inhibitor: | 0.696 | CYP2C19-substrate: | 0.356 |
| CYP2C9-inhibitor: | 0.463 | CYP2C9-substrate: | 0.918 |
| CYP2D6-inhibitor: | 0.694 | CYP2D6-substrate: | 0.529 |
| CYP3A4-inhibitor: | 0.144 | CYP3A4-substrate: | 0.169 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 4.529 | Half-life (T1/2): | 0.453 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.076 | Human Hepatotoxicity (H-HT): | 0.052 |
| Drug-inuced Liver Injury (DILI): | 0.781 | AMES Toxicity: | 0.006 |
| Rat Oral Acute Toxicity: | 0.087 | Maximum Recommended Daily Dose: | 0.027 |
| Skin Sensitization: | 0.061 | Carcinogencity: | 0.036 |
| Eye Corrosion: | 0.005 | Eye Irritation: | 0.427 |
| Respiratory Toxicity: | 0.059 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004033 |  |
1.000 | D03XTC |  |
0.321 | ||
| ENC004034 |  |
1.000 | D01UXC |  |
0.312 | ||
| ENC000096 |  |
0.604 | D0R1QE |  |
0.309 | ||
| ENC002111 |  |
0.475 | D02HXS |  |
0.306 | ||
| ENC004143 |  |
0.443 | D0I2MK |  |
0.291 | ||
| ENC006094 |  |
0.338 | D0HD9K |  |
0.281 | ||
| ENC005813 |  |
0.321 | D03LGG |  |
0.279 | ||
| ENC000586 |  |
0.316 | D0U5CE |  |
0.279 | ||
| ENC000074 |  |
0.312 | D0KD1U |  |
0.278 | ||
| ENC004665 |  |
0.309 | D08HQK |  |
0.275 | ||