![]() |
Name |
(3R)-5-oxo-de-O-methyllasiodiplodin
|
Molecular Formula | C16H20O5 | |
IUPAC Name* |
(4R)-14,16-dihydroxy-4-methyl-3-oxabicyclo[10.4.0]hexadeca-1(12),13,15-triene-2,6-dione
|
|
SMILES |
C[C@@H]1CC(=O)CCCCCC2=C(C(=CC(=C2)O)O)C(=O)O1
|
|
InChI |
InChI=1S/C16H20O5/c1-10-7-12(17)6-4-2-3-5-11-8-13(18)9-14(19)15(11)16(20)21-10/h8-10,18-19H,2-7H2,1H3/t10-/m1/s1
|
|
InChIKey |
KZOIYIPDPQANFM-SNVBAGLBSA-N
|
|
Synonyms |
(3R)-5-oxo-de-O-methyllasiodiplodin
|
|
CAS | NA | |
PubChem CID | 139590426 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 292.33 | ALogp: | 3.2 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 83.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 21 | QED Weighted: | 0.715 |
Caco-2 Permeability: | -4.777 | MDCK Permeability: | 0.00002850 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.008 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.813 |
30% Bioavailability (F30%): | 0.054 |
Blood-Brain-Barrier Penetration (BBB): | 0.139 | Plasma Protein Binding (PPB): | 91.48% |
Volume Distribution (VD): | 0.628 | Fu: | 8.79% |
CYP1A2-inhibitor: | 0.954 | CYP1A2-substrate: | 0.255 |
CYP2C19-inhibitor: | 0.742 | CYP2C19-substrate: | 0.061 |
CYP2C9-inhibitor: | 0.698 | CYP2C9-substrate: | 0.955 |
CYP2D6-inhibitor: | 0.883 | CYP2D6-substrate: | 0.497 |
CYP3A4-inhibitor: | 0.577 | CYP3A4-substrate: | 0.115 |
Clearance (CL): | 13.293 | Half-life (T1/2): | 0.907 |
hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.184 |
Drug-inuced Liver Injury (DILI): | 0.55 | AMES Toxicity: | 0.058 |
Rat Oral Acute Toxicity: | 0.087 | Maximum Recommended Daily Dose: | 0.737 |
Skin Sensitization: | 0.514 | Carcinogencity: | 0.052 |
Eye Corrosion: | 0.013 | Eye Irritation: | 0.672 |
Respiratory Toxicity: | 0.298 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005002 | ![]() |
0.813 | D07MGA | ![]() |
0.308 | ||
ENC005001 | ![]() |
0.776 | D0P6VV | ![]() |
0.267 | ||
ENC003872 | ![]() |
0.758 | D07GRH | ![]() |
0.266 | ||
ENC002297 | ![]() |
0.701 | D00ZFP | ![]() |
0.264 | ||
ENC005003 | ![]() |
0.701 | D02NSF | ![]() |
0.263 | ||
ENC005007 | ![]() |
0.694 | D04JHN | ![]() |
0.255 | ||
ENC002701 | ![]() |
0.681 | D03YVO | ![]() |
0.245 | ||
ENC001527 | ![]() |
0.644 | D03WAJ | ![]() |
0.241 | ||
ENC003158 | ![]() |
0.634 | D0PG8O | ![]() |
0.240 | ||
ENC003244 | ![]() |
0.634 | D0H6QU | ![]() |
0.237 |