|
Name |
Isoversicolorin C
|
Molecular Formula | C18H12O7 | |
IUPAC Name* |
(4S,8R)-10,16,18-trihydroxy-3,5-dioxapentacyclo[10.8.0.02,9.04,8.014,19]icosa-1,9,11,14(19),15,17-hexaene-13,20-dione
|
|
SMILES |
C1CO[C@@H]2[C@H]1C3=C(C=C4C(=C3O2)C(=O)C5=C(C4=O)C=C(C=C5O)O)O
|
|
InChI |
InChI=1S/C18H12O7/c19-6-3-8-12(10(20)4-6)16(23)14-9(15(8)22)5-11(21)13-7-1-2-24-18(7)25-17(13)14/h3-5,7,18-21H,1-2H2/t7-,18+/m1/s1
|
|
InChIKey |
LOJIMYUULYNTHG-MDTSDYNXSA-N
|
|
Synonyms |
Isoversicolorin C
|
|
CAS | NA | |
PubChem CID | 139589550 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 340.3 | ALogp: | 2.3 |
HBD: | 3 | HBA: | 7 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 113.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 25 | QED Weighted: | 0.576 |
Caco-2 Permeability: | -5.325 | MDCK Permeability: | 0.00000727 |
Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.568 | 20% Bioavailability (F20%): | 0.04 |
30% Bioavailability (F30%): | 0.985 |
Blood-Brain-Barrier Penetration (BBB): | 0.003 | Plasma Protein Binding (PPB): | 92.80% |
Volume Distribution (VD): | 0.561 | Fu: | 16.65% |
CYP1A2-inhibitor: | 0.953 | CYP1A2-substrate: | 0.188 |
CYP2C19-inhibitor: | 0.046 | CYP2C19-substrate: | 0.05 |
CYP2C9-inhibitor: | 0.639 | CYP2C9-substrate: | 0.748 |
CYP2D6-inhibitor: | 0.055 | CYP2D6-substrate: | 0.227 |
CYP3A4-inhibitor: | 0.083 | CYP3A4-substrate: | 0.027 |
Clearance (CL): | 10.277 | Half-life (T1/2): | 0.853 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.224 |
Drug-inuced Liver Injury (DILI): | 0.986 | AMES Toxicity: | 0.503 |
Rat Oral Acute Toxicity: | 0.083 | Maximum Recommended Daily Dose: | 0.795 |
Skin Sensitization: | 0.921 | Carcinogencity: | 0.383 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.897 |
Respiratory Toxicity: | 0.134 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000843 | 0.795 | D07MGA | 0.337 | ||||
ENC000864 | 0.600 | D0K8KX | 0.300 | ||||
ENC002434 | 0.587 | D04AIT | 0.293 | ||||
ENC000094 | 0.550 | D0AZ8C | 0.282 | ||||
ENC001429 | 0.543 | D01XDL | 0.254 | ||||
ENC003182 | 0.543 | D01XWG | 0.254 | ||||
ENC001929 | 0.541 | D0T8EH | 0.250 | ||||
ENC004746 | 0.532 | D0C9XJ | 0.248 | ||||
ENC001058 | 0.530 | D07VLY | 0.248 | ||||
ENC002296 | 0.512 | D0N1FS | 0.243 |