|
Name |
1,3,6,8-tetrahydroxy-2-[(2S,6S)-6-methyloxan-2-yl]anthracene-9,10-dione
|
Molecular Formula | C20H18O7 | |
IUPAC Name* |
1,3,6,8-tetrahydroxy-2-[(2S,6S)-6-methyloxan-2-yl]anthracene-9,10-dione
|
|
SMILES |
C[C@H]1CCC[C@H](O1)C2=C(C=C3C(=C2O)C(=O)C4=C(C3=O)C=C(C=C4O)O)O
|
|
InChI |
InChI=1S/C20H18O7/c1-8-3-2-4-14(27-8)17-13(23)7-11-16(20(17)26)19(25)15-10(18(11)24)5-9(21)6-12(15)22/h5-8,14,21-23,26H,2-4H2,1H3/t8-,14-/m0/s1
|
|
InChIKey |
RMAWHAJLOCVQTG-RTHLEPHNSA-N
|
|
Synonyms |
Averufanin; 28458-24-4; 1,3,6,8-tetrahydroxy-2-[(2S,6S)-6-methyloxan-2-yl]anthracene-9,10-dione; SCHEMBL15676485; DTXSID60951105; 1,3,6,8-Tetrahydroxy-2-(6-methyloxan-2-yl)anthracene-9,10-dione; 1,3,6,8-Tetrahydroxy-2-[(2alpha,6alpha)-tetrahydro-6-methyl-2H-pyran-2-yl]-9,10-anthracenedione; 9,10-Anthracenedione, 1,3,6,8-tetrahydroxy-2-((2R,6R)-tetrahydro-6-methyl-2H-pyran-2-yl)-, rel-(+)-; 9,10-Anthracenedione, 1,3,6,8-tetrahydroxy-2-(tetrahydro-6-methyl-2H-pyran-2-yl)-, cis-(+)- (VAN)
|
|
CAS | 28458-24-4 | |
PubChem CID | 119255 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 370.4 | ALogp: | 3.0 |
HBD: | 4 | HBA: | 7 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 124.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 27 | QED Weighted: | 0.515 |
Caco-2 Permeability: | -5.547 | MDCK Permeability: | 0.00001380 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.036 | 20% Bioavailability (F20%): | 0.412 |
30% Bioavailability (F30%): | 0.995 |
Blood-Brain-Barrier Penetration (BBB): | 0.003 | Plasma Protein Binding (PPB): | 97.33% |
Volume Distribution (VD): | 0.497 | Fu: | 8.30% |
CYP1A2-inhibitor: | 0.916 | CYP1A2-substrate: | 0.163 |
CYP2C19-inhibitor: | 0.056 | CYP2C19-substrate: | 0.049 |
CYP2C9-inhibitor: | 0.597 | CYP2C9-substrate: | 0.617 |
CYP2D6-inhibitor: | 0.405 | CYP2D6-substrate: | 0.201 |
CYP3A4-inhibitor: | 0.094 | CYP3A4-substrate: | 0.047 |
Clearance (CL): | 7.191 | Half-life (T1/2): | 0.777 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.602 |
Drug-inuced Liver Injury (DILI): | 0.588 | AMES Toxicity: | 0.638 |
Rat Oral Acute Toxicity: | 0.017 | Maximum Recommended Daily Dose: | 0.9 |
Skin Sensitization: | 0.941 | Carcinogencity: | 0.539 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.873 |
Respiratory Toxicity: | 0.63 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001429 | 0.637 | D07MGA | 0.337 | ||||
ENC000843 | 0.600 | D0K8KX | 0.327 | ||||
ENC003823 | 0.600 | D01XDL | 0.313 | ||||
ENC003182 | 0.585 | D01XWG | 0.311 | ||||
ENC004746 | 0.574 | D04AIT | 0.307 | ||||
ENC002067 | 0.554 | D0C9XJ | 0.304 | ||||
ENC005076 | 0.552 | D07VLY | 0.304 | ||||
ENC001929 | 0.552 | D0T8EH | 0.284 | ||||
ENC000935 | 0.552 | D0AZ8C | 0.274 | ||||
ENC000335 | 0.548 | D01UBX | 0.273 |