|
Name |
[(2S)-4-[[(3S)-1-hydroxy-2-oxoazepan-3-yl]amino]-4-oxobutan-2-yl] (2S)-6-[hydroxy-[(E)-octadec-2-enoyl]amino]-2-[[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]hexanoate
|
Molecular Formula | C44H69N5O10 | |
IUPAC Name* |
[(2S)-4-[[(3S)-1-hydroxy-2-oxoazepan-3-yl]amino]-4-oxobutan-2-yl] (2S)-6-[hydroxy-[(E)-octadec-2-enoyl]amino]-2-[[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-oxazole-4-carbonyl]amino]hexanoate
|
|
SMILES |
CCCCCCCCCCCCCCC/C=C/C(=O)N(CCCC[C@@H](C(=O)O[C@@H](C)CC(=O)N[C@H]1CCCCN(C1=O)O)NC(=O)[C@@H]2COC(=N2)C3=CC=CC=C3O)O
|
|
InChI |
InChI=1S/C44H69N5O10/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-28-40(52)48(56)29-22-21-26-36(46-41(53)37-32-58-42(47-37)34-24-18-19-27-38(34)50)44(55)59-33(2)31-39(51)45-35-25-20-23-30-49(57)43(35)54/h17-19,24,27-28,33,35-37,50,56-57H,3-16,20-23,25-26,29-32H2,1-2H3,(H,45,51)(H,46,53)/b28-17+/t33-,35-,36-,37-/m0/s1
|
|
InChIKey |
DQMISKWZRFJSGS-AOXGLPOYSA-N
|
|
Synonyms |
Mycobactin S
|
|
CAS | NA | |
PubChem CID | 136703988 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 828.0 | ALogp: | 8.6 |
HBD: | 5 | HBA: | 11 |
Rotatable Bonds: | 29 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 207.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 59 | QED Weighted: | 0.02 |
Caco-2 Permeability: | -5.358 | MDCK Permeability: | 0.00003470 |
Pgp-inhibitor: | 0.324 | Pgp-substrate: | 0.997 |
Human Intestinal Absorption (HIA): | 0.896 | 20% Bioavailability (F20%): | 1 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.004 | Plasma Protein Binding (PPB): | 98.90% |
Volume Distribution (VD): | 1.33 | Fu: | 1.22% |
CYP1A2-inhibitor: | 0.077 | CYP1A2-substrate: | 0.077 |
CYP2C19-inhibitor: | 0.593 | CYP2C19-substrate: | 0.041 |
CYP2C9-inhibitor: | 0.707 | CYP2C9-substrate: | 0.978 |
CYP2D6-inhibitor: | 0.059 | CYP2D6-substrate: | 0.125 |
CYP3A4-inhibitor: | 0.934 | CYP3A4-substrate: | 0.025 |
Clearance (CL): | 6.623 | Half-life (T1/2): | 0.029 |
hERG Blockers: | 0.706 | Human Hepatotoxicity (H-HT): | 0.834 |
Drug-inuced Liver Injury (DILI): | 0.514 | AMES Toxicity: | 0.077 |
Rat Oral Acute Toxicity: | 0.048 | Maximum Recommended Daily Dose: | 0.976 |
Skin Sensitization: | 0.499 | Carcinogencity: | 0.488 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.759 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003077 | 0.349 | D00STJ | 0.319 | ||||
ENC001039 | 0.335 | D0T9TJ | 0.312 | ||||
ENC000509 | 0.328 | D07ILQ | 0.275 | ||||
ENC000293 | 0.325 | D0OR6A | 0.272 | ||||
ENC001678 | 0.320 | D00AOJ | 0.265 | ||||
ENC001803 | 0.320 | D0J8IJ | 0.264 | ||||
ENC003072 | 0.320 | D0O1PH | 0.259 | ||||
ENC001553 | 0.318 | D0P1RL | 0.259 | ||||
ENC000156 | 0.318 | D0FJ8A | 0.257 | ||||
ENC002790 | 0.314 | D0Z1QC | 0.253 |