|
Name |
l-Leucine, N-cyclopropylcarbonyl-, hexadecyl ester
|
Molecular Formula | C26H49NO3 | |
IUPAC Name* |
hexadecyl 2-(cyclopropanecarbonylamino)-4-methylpentanoate
|
|
SMILES |
CCCCCCCCCCCCCCCCOC(=O)C(CC(C)C)NC(=O)C1CC1
|
|
InChI |
InChI=1S/C26H49NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-30-26(29)24(21-22(2)3)27-25(28)23-18-19-23/h22-24H,4-21H2,1-3H3,(H,27,28)
|
|
InChIKey |
LZBWPYUZOKAADA-UHFFFAOYSA-N
|
|
Synonyms |
l-Leucine, N-cyclopropylcarbonyl-, hexadecyl ester
|
|
CAS | NA | |
PubChem CID | 91721477 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 423.7 | ALogp: | 9.4 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 21 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 55.4 | Aromatic Rings: | 1 |
Heavy Atoms: | 30 | QED Weighted: | 0.171 |
Caco-2 Permeability: | -4.88 | MDCK Permeability: | 0.00001780 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.001 | 20% Bioavailability (F20%): | 0.915 |
30% Bioavailability (F30%): | 0.996 |
Blood-Brain-Barrier Penetration (BBB): | 0.044 | Plasma Protein Binding (PPB): | 97.23% |
Volume Distribution (VD): | 0.871 | Fu: | 1.90% |
CYP1A2-inhibitor: | 0.064 | CYP1A2-substrate: | 0.235 |
CYP2C19-inhibitor: | 0.423 | CYP2C19-substrate: | 0.103 |
CYP2C9-inhibitor: | 0.201 | CYP2C9-substrate: | 0.954 |
CYP2D6-inhibitor: | 0.321 | CYP2D6-substrate: | 0.105 |
CYP3A4-inhibitor: | 0.633 | CYP3A4-substrate: | 0.138 |
Clearance (CL): | 3.428 | Half-life (T1/2): | 0.053 |
hERG Blockers: | 0.728 | Human Hepatotoxicity (H-HT): | 0.228 |
Drug-inuced Liver Injury (DILI): | 0.523 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.056 | Maximum Recommended Daily Dose: | 0.01 |
Skin Sensitization: | 0.933 | Carcinogencity: | 0.048 |
Eye Corrosion: | 0.009 | Eye Irritation: | 0.052 |
Respiratory Toxicity: | 0.685 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000424 | 0.602 | D07ILQ | 0.485 | ||||
ENC000488 | 0.568 | D00FGR | 0.472 | ||||
ENC001124 | 0.548 | D0T9TJ | 0.468 | ||||
ENC001234 | 0.548 | D0Z5SM | 0.453 | ||||
ENC000575 | 0.548 | D00AOJ | 0.425 | ||||
ENC003070 | 0.547 | D05ATI | 0.394 | ||||
ENC001243 | 0.546 | D0O1PH | 0.364 | ||||
ENC001218 | 0.546 | D00MLW | 0.355 | ||||
ENC001161 | 0.542 | D00STJ | 0.347 | ||||
ENC000316 | 0.538 | D03ZJE | 0.324 |