|
Name |
Aspernigrin B
|
Molecular Formula | C27H24N2O5 | |
IUPAC Name* |
6-benzyl-1-[(1S)-1-(4-methoxy-6-oxopyran-2-yl)-2-phenylethyl]-4-oxopyridine-3-carboxamide
|
|
SMILES |
COC1=CC(=O)OC(=C1)[C@H](CC2=CC=CC=C2)N3C=C(C(=O)C=C3CC4=CC=CC=C4)C(=O)N
|
|
InChI |
InChI=1S/C27H24N2O5/c1-33-21-15-25(34-26(31)16-21)23(13-19-10-6-3-7-11-19)29-17-22(27(28)32)24(30)14-20(29)12-18-8-4-2-5-9-18/h2-11,14-17,23H,12-13H2,1H3,(H2,28,32)/t23-/m0/s1
|
|
InChIKey |
CPVCVIXCXKPURM-QHCPKHFHSA-N
|
|
Synonyms |
Aspernigrin B; 773855-63-3; CHEMBL3746659; CHEBI:133847; DTXSID501107438; 1,4-Dihydro-1-[(1S)-1-(4-methoxy-2-oxo-2H-pyran-6-yl)-2-phenylethyl]-4-oxo-6-(phenylmethyl)-3-pyridinecarboxamide; 6-benzyl-1-[(1S)-1-(4-methoxy-2-oxo-2H-pyran-6-yl)-2-phenylethyl]-4-oxo-1,4-dihydropyridine-3-carboxamide; 6-benzyl-1-[(1S)-1-(4-methoxy-6-oxo-pyran-2-yl)-2-phenyl-ethyl]-4-oxo-pyridine-3-carboxamide
|
|
CAS | 773855-63-3 | |
PubChem CID | 126456438 | |
ChEMBL ID | CHEMBL3746659 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 456.5 | ALogp: | 3.9 |
HBD: | 1 | HBA: | 6 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 98.9 | Aromatic Rings: | 4 |
Heavy Atoms: | 34 | QED Weighted: | 0.43 |
Caco-2 Permeability: | -5.001 | MDCK Permeability: | 0.00001710 |
Pgp-inhibitor: | 0.897 | Pgp-substrate: | 0.911 |
Human Intestinal Absorption (HIA): | 0.032 | 20% Bioavailability (F20%): | 0.793 |
30% Bioavailability (F30%): | 0.966 |
Blood-Brain-Barrier Penetration (BBB): | 0.194 | Plasma Protein Binding (PPB): | 100.30% |
Volume Distribution (VD): | 0.648 | Fu: | 0.74% |
CYP1A2-inhibitor: | 0.219 | CYP1A2-substrate: | 0.774 |
CYP2C19-inhibitor: | 0.925 | CYP2C19-substrate: | 0.079 |
CYP2C9-inhibitor: | 0.94 | CYP2C9-substrate: | 0.849 |
CYP2D6-inhibitor: | 0.102 | CYP2D6-substrate: | 0.495 |
CYP3A4-inhibitor: | 0.903 | CYP3A4-substrate: | 0.838 |
Clearance (CL): | 8.544 | Half-life (T1/2): | 0.182 |
hERG Blockers: | 0.396 | Human Hepatotoxicity (H-HT): | 0.586 |
Drug-inuced Liver Injury (DILI): | 0.977 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.193 | Maximum Recommended Daily Dose: | 0.962 |
Skin Sensitization: | 0.032 | Carcinogencity: | 0.274 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.009 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005604 | 0.444 | D0T5UL | 0.367 | ||||
ENC005618 | 0.437 | D0G1VX | 0.333 | ||||
ENC005603 | 0.432 | D0U5GB | 0.320 | ||||
ENC003342 | 0.364 | D0E3OF | 0.317 | ||||
ENC003616 | 0.350 | D0J5RN | 0.313 | ||||
ENC003697 | 0.346 | D07HQC | 0.313 | ||||
ENC001449 | 0.345 | D0HF0W | 0.312 | ||||
ENC000077 | 0.333 | D09VXM | 0.312 | ||||
ENC001442 | 0.331 | D03DEI | 0.312 | ||||
ENC000302 | 0.330 | D08QIP | 0.310 |